5,6-DIMETHOXY-1H-INDOLE
5,6-Dimethoxyindole
CAS: 14430-23-0
Molecular Formula: C10H11NO2
5,6-DIMETHOXY-1H-INDOLE - Names and Identifiers
| Name | 5,6-Dimethoxyindole |
| Synonyms | AKOS JY2083477 5,6-Dimethoxyindole 5,6-DIMETHOXYINDOLE 5,6-Dimethoxy-1H-indole 5,6-DIMETHOXY-1H-INDOLE 1H-Indole, 5,6-dimethoxy- |
| CAS | 14430-23-0 |
| EINECS | 238-402-5 |
| InChI | InChI=1/C10H11NO2/c1-12-9-5-7-3-4-11-8(7)6-10(9)13-2/h3-6,11H,1-2H3 |
| InChIKey | QODBZRNBPUPLEZ-UHFFFAOYSA-N |
5,6-DIMETHOXY-1H-INDOLE - Physico-chemical Properties
| Molecular Formula | C10H11NO2 |
| Molar Mass | 177.2 |
| Density | 1.182±0.06 g/cm3(Predicted) |
| Melting Point | 154-157 °C (lit.) |
| Boling Point | 198°C 8mm |
| Flash Point | 198°C/8mm |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.0006mmHg at 25°C |
| Appearance | Similar to white crystalline powder |
| Color | Beige |
| Maximum wavelength(λmax) | ['306nm(EtOH)(lit.)'] |
| BRN | 5683 |
| pKa | 16.93±0.30(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.608 |
| MDL | MFCD00005675 |
5,6-DIMETHOXY-1H-INDOLE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |
5,6-DIMETHOXY-1H-INDOLE - Introduction
5,6-dimethoxyindole is an organic compound with the chemical formula C11H11NO2. It has the following properties:
1. Appearance: 5,6-dimethoxyindole is white crystal or crystalline powder.
2. Melting Point: about 148-150 ℃.
3. Solubility: 5,6-dimethoxyindole is soluble in most organic solvents, such as ethanol, dimethyl sulfoxide, etc.
4. Chemical reaction: under acidic conditions, 5,6-dimethoxyindole can be attacked by nucleophiles to form different products.
5,6-dimethoxyindole has some applications and uses:
1. Fluorescent probe: 5,6-dimethoxyindole can enhance the diffraction ability through conjugate effect and is used as a fluorescent probe.
2. Organic synthesis intermediate: It is used as a synthetic intermediate of organic compounds and can be used to prepare other organic compounds, such as medicines and dyes.
The method of preparing 5,6-dimethoxyindole generally includes the following steps:
1. React indole with methoxylation reagent (such as methyl azodimethyl ester) to generate 5-methoxy indole.
2. React 5-methoxyindole with methylene reagent (such as ketone formate) and carry out C- alkylation reaction under alkaline conditions to generate 5,6-dimethoxyindole.
Regarding the safety information of 5,6-dimethoxyindole, there is basically no detailed information for reference. But in general, because it is a chemical synthesis intermediate, may have a certain potential danger. Therefore, appropriate safety measures should be taken during handling and use, such as wearing protective gloves, safety glasses and laboratory clothes to avoid direct contact. In addition, the appropriate chemical safety procedures and operating guidelines should be understood and followed prior to operation.
1. Appearance: 5,6-dimethoxyindole is white crystal or crystalline powder.
2. Melting Point: about 148-150 ℃.
3. Solubility: 5,6-dimethoxyindole is soluble in most organic solvents, such as ethanol, dimethyl sulfoxide, etc.
4. Chemical reaction: under acidic conditions, 5,6-dimethoxyindole can be attacked by nucleophiles to form different products.
5,6-dimethoxyindole has some applications and uses:
1. Fluorescent probe: 5,6-dimethoxyindole can enhance the diffraction ability through conjugate effect and is used as a fluorescent probe.
2. Organic synthesis intermediate: It is used as a synthetic intermediate of organic compounds and can be used to prepare other organic compounds, such as medicines and dyes.
The method of preparing 5,6-dimethoxyindole generally includes the following steps:
1. React indole with methoxylation reagent (such as methyl azodimethyl ester) to generate 5-methoxy indole.
2. React 5-methoxyindole with methylene reagent (such as ketone formate) and carry out C- alkylation reaction under alkaline conditions to generate 5,6-dimethoxyindole.
Regarding the safety information of 5,6-dimethoxyindole, there is basically no detailed information for reference. But in general, because it is a chemical synthesis intermediate, may have a certain potential danger. Therefore, appropriate safety measures should be taken during handling and use, such as wearing protective gloves, safety glasses and laboratory clothes to avoid direct contact. In addition, the appropriate chemical safety procedures and operating guidelines should be understood and followed prior to operation.
Last Update：2024-04-09 21:54:55
Supplier List
Product Name: 5,6-Dimethoxyindole Visit Supplier Webpage Request for quotation
CAS: 14430-23-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 14430-23-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5,6-Dimethoxyindole Visit Supplier Webpage Request for quotation
CAS: 14430-23-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 14430-23-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History