5,6-Diaza-1,10-phenanthroline

5,6-Diaza-1,10-phenanthroline - Names and Identifiers

Name	dipyrido[3,2-c:2',3'-e]pyridazine
Synonyms	4,5,9,10-TETRAAZAPHENANTHRENE 1,5,6,10-Tetraazaphenanthrene 4,5,9,10-Tetraazaphenanthrene 5,6-Diaza-1,10-phenanthroline
CAS	653-05-4
InChI	InChI=1/C10H6N4/c1-3-7-9(11-5-1)10-8(14-13-7)4-2-6-12-10/h1-6H

5,6-Diaza-1,10-phenanthroline - Physico-chemical Properties

Molecular Formula	C10H6N4
Molar Mass	182.18
Density	1.395±0.06 g/cm3(Predicted)
Melting Point	225-230
Boling Point	395.7°C at 760 mmHg
Flash Point	219.6°C
Vapor Presure	4.11E-06mmHg at 25°C
pKa	0.22±0.30(Predicted)
Storage Condition	2-8°C
Refractive Index	1.77

5,6-Diaza-1,10-phenanthroline - Introduction

dipyrido[3,2-c:2 ',3'-e]pyridazine is a heterocyclic compound containing four nitrogen atoms and has the formula C12H6N4. Its properties are as follows:

1. Appearance: dipyrido[3,2-c:2 ',3'-e] was pyridazine as a pale yellow solid.
2. Melting point: It has a higher melting point, about 240-245 degrees Celsius.
3. Solubility: dipyrido[3,2-c:2 ',3'-e]pyridazine has good solubility in common organic solvents.

dipyrido[3,2-c:2 ',3'-e]pyridazine have some important applications and uses, including:

1. As an organic dye: Due to its special molecular structure and light absorption properties, dipyrido[3,2-c:2 ',3'-e]pyridazine can be used as an organic dye for the preparation of dyes and pigments.
2. Optoelectronic devices: dipyrido[3,2-c:2 ',3'-e]pyridazine material properties make it have potential applications in optoelectronic devices, such as organic photoelectric conversion devices and organic light-emitting diodes (OLED), etc.

There are two common methods for preparing dipyrido[3,2-c:2 ',3'-e]pyridazine:

1. Through organic synthesis: Through appropriate organic synthesis routes, dipyrido[3,2-c:2 ',3'-e]pyridazine can be synthesized from suitable starting materials. These synthetic routes may include cyclization reactions, nitrogen atom doping reactions, and the like.
2. Modification by other compounds: In some cases, the dipyrido[3,2-c:2 ',3'-e]pyridazine may be formed in the reaction by modifying or reacting other compounds.

When using and handling dipyrido[3,2-c:2 ',3'-e]pyridazine, the following safety information needs to be noted:

1. Toxicity: dipyrido[3,2-c:2 ',3'-e]pyridazine may cause some adverse effects on human body when inhaled in large quantities or exposed for a long time. Therefore, it is necessary to wear appropriate protective equipment, such as gloves, masks and goggles, when in use.
2. extinguishing agent: when extinguishing fire, appropriate extinguishing agent should be used, such as carbon dioxide, dry powder extinguishing agent, etc.
3. Storage and disposal: dipyrido[3,2-c:2 ',3'-e]pyridazine should be stored in sealed containers, away from ignition and oxidizing agents. When discarded, comply with local waste disposal regulations and treat it as hazardous waste.

Generally speaking, dipyrido[3,2-c:2 ',3'-e]pyridazine is an organic compound with potential applications, but it should be used with caution and follow relevant safety procedures.

Last Update：2024-04-10 22:29:15