5,6-methylenedioxy-2-aminoindan - Names and Identifiers
| Name | 5,6-methylenedioxy-2-aminoindan
|
| Synonyms | MDAI
5,6-methylenedioxy-2-aminoindan
6,7-Dihydro-5H-indeno[5,6-d]-1,3-dioxol-6-amine
6,7-dihydro-5h-indeno(5,6-d)-1,3-dioxol-6-amine
|
| CAS | 132741-81-2
|
| InChI | InChI=1/C10H11NO2/c11-8-1-6-3-9-10(13-5-12-9)4-7(6)2-8/h3-4,8H,1-2,5,11H2 |
5,6-methylenedioxy-2-aminoindan - Physico-chemical Properties
| Molecular Formula | C10H11NO2
|
| Molar Mass | 177.2 |
| Density | 1.29g/cm3 |
| Boling Point | 312.4°C at 760 mmHg |
| Flash Point | 155.9°C |
| Vapor Presure | 0.000529mmHg at 25°C |
| Refractive Index | 1.618 |
5,6-methylenedioxy-2-aminoindan - Introduction
5,6-Methylenedioxy-2-aminoindene is an organic compound with the chemical formula C11H11NO2. It is a white crystalline solid, soluble in most organic solvents. The following is a description of the nature, use, preparation and safety information of 5,6-methylenedioxy-2-aminoindene:
Nature:
1. Appearance: White crystalline solid.
2. melting point: about 200-205 degrees Celsius.
3. Solubility: Soluble in most organic solvents, such as alcohol, ether, ketone, etc.
4. Stability: 5,6-methylenedioxy-2-aminoindene is relatively stable at room temperature, but will be affected by light and oxygen.
5. combustion: with flammability.
Use:
5,6-methylenedioxy-2-aminoindene is mainly used for the preparation of dyes, pigments and fluorescent dyes and other organic compounds. It can be used as an intermediate to participate in organic synthesis reactions for the preparation of other organic compounds.
Preparation Method:
There are many preparation methods of 5,6-methylenedioxy-2-aminoindene, and a common method is to start synthesis from 2-nitronaphthalene. Specific steps include nitration, reduction, methylation, and aminolysis.
Safety Information:
1. 5,6-Methylenedioxy-2-aminoindene is an organic compound that is sensitive to the skin, eyes and respiratory system. Pay attention to protective measures during operation, such as wearing protective glasses, gloves and protective masks.
2. avoid contact with strong oxidant, avoid high temperature and open fire.
3. if the external contact to the skin or eyes, should immediately rinse with plenty of water, and seek medical help.
4. When using, storing and handling 5,6-methylenedioxy-2-aminoindene, care should be taken to comply with relevant safety operating guidelines and scientific laboratory specifications.
Last Update：2024-04-10 22:29:15