5-(2-THIENYL)-1H-TETRAZOLE
5-(Thien-2-yl)-1H-tetrazole
CAS: 59541-58-1
Molecular Formula: C5H4N4S
5-(2-THIENYL)-1H-TETRAZOLE - Names and Identifiers
| Name | 5-(Thien-2-yl)-1H-tetrazole |
| Synonyms | Nsc37373 AKOS 206-02 5-(2-THIENYL)-1H-TETRAZOLE 5-thien-2-yl-2H-tetraazole 5-(Thien-2-yl)-1H-tetrazole 5-(thiophen-2-yl)-2H-tetrazole |
| CAS | 59541-58-1 |
| InChI | InChI=1/C5H4N4S/c1-2-4(10-3-1)5-6-8-9-7-5/h1-3H,(H,6,7,8,9) |
5-(2-THIENYL)-1H-TETRAZOLE - Physico-chemical Properties
| Molecular Formula | C5H4N4S |
| Molar Mass | 152.18 |
| Density | 1.489g/cm3 |
| Boling Point | 357.163°C at 760 mmHg |
| Flash Point | 178.327°C |
| Vapor Presure | 0mmHg at 25°C |
| Refractive Index | 1.665 |
5-(2-THIENYL)-1H-TETRAZOLE - Introduction
5-(Thien-2-yl)-1H-tetra ole(5-(Thien-2-yl)-1H-tetra ole) is an organic compound with the following properties:
1. Appearance: colorless to light yellow solid.
2. Melting point: about 100-105°C.
3. Solubility: Soluble in common organic solvents such as dimethylformamide (DMF) and dichloromethane.
4. Chemical properties: The compound is highly reactive and easily reacts with other compounds.
5. use: 5-(Thien-2-yl)-1H-tetrazole is widely used in organic synthesis. It can be used as a pharmaceutical intermediate, dye material, etc.
Preparation method: There are many ways to prepare 5-(Thien-2-yl)-1H-tetrazole. One common method is to synthesize through a series reaction. First, thiophene was synthesized by thiophene, then thiophene ketone reacted with sodium nitride to generate an intermediate, and finally the intermediate reacted with hydrogen peroxide to obtain the target product 5-(Thien-2-yl)-1H-tetrazole.
Safety information: The compound is generally stable and safe under correct operating conditions, but the following should be noted:
1. Avoid contact with oxidants, high temperatures and open flames during operation and storage.
2. When using the compound, properly wear personal protective equipment, such as lab gloves and goggles, and avoid contact with eyes and skin.
3. Avoid inhaling the dust and gas of the compound, and maintain good ventilation during operation.
4. in the use and disposal process, should follow the general safety practice of chemicals, and properly dispose of waste.
In summary, 5-(Thien-2-yl)-1H-tetrazole is an organic compound with a wide range of application prospects, but it is necessary to pay attention to safe use during operation.
1. Appearance: colorless to light yellow solid.
2. Melting point: about 100-105°C.
3. Solubility: Soluble in common organic solvents such as dimethylformamide (DMF) and dichloromethane.
4. Chemical properties: The compound is highly reactive and easily reacts with other compounds.
5. use: 5-(Thien-2-yl)-1H-tetrazole is widely used in organic synthesis. It can be used as a pharmaceutical intermediate, dye material, etc.
Preparation method: There are many ways to prepare 5-(Thien-2-yl)-1H-tetrazole. One common method is to synthesize through a series reaction. First, thiophene was synthesized by thiophene, then thiophene ketone reacted with sodium nitride to generate an intermediate, and finally the intermediate reacted with hydrogen peroxide to obtain the target product 5-(Thien-2-yl)-1H-tetrazole.
Safety information: The compound is generally stable and safe under correct operating conditions, but the following should be noted:
1. Avoid contact with oxidants, high temperatures and open flames during operation and storage.
2. When using the compound, properly wear personal protective equipment, such as lab gloves and goggles, and avoid contact with eyes and skin.
3. Avoid inhaling the dust and gas of the compound, and maintain good ventilation during operation.
4. in the use and disposal process, should follow the general safety practice of chemicals, and properly dispose of waste.
In summary, 5-(Thien-2-yl)-1H-tetrazole is an organic compound with a wide range of application prospects, but it is necessary to pay attention to safe use during operation.
Last Update：2024-04-09 21:01:54
Supplier List
Product Name: 5-(2-THIENYL)-1H-TETRAZOLE Visit Supplier Webpage Request for quotation
CAS: 59541-58-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 59541-58-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-(2-THIENYL)-1H-TETRAZOLE Visit Supplier Webpage Request for quotation
CAS: 59541-58-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 59541-58-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History