5-Aminobenzimidazole
5-Aminobenzimidazole
CAS: 55299-95-1
Molecular Formula: C7H7N3
5-Aminobenzimidazole - Names and Identifiers
| Name | 5-Aminobenzimidazole |
| Synonyms | Nsc11998 5-Aminobenzimidazole 5-AMINOBENZIMIDAZOLE 1H-benzimidazol-6-amine 1H-BENZIMIDAZOL-5-YLAMINE 1H-BENZOIMIDAZOL-5-YLAMINE 1H-benzo[d]imidazol-5-amine 1H-1,3-Benzimidazol-5-amine 1H-1,3-BENZIMIDAZOL-5-AMINE 5-Aminobenzimidazolehydrochloride 1H-Benzo[d]iMidazol-6-aMine dihydrochloride |
| CAS | 55299-95-1 |
| EINECS | 213-279-0 |
| InChI | InChI=1/C7H7N3.ClH/c8-5-1-2-6-7(3-5)10-4-9-6;/h1-4H,8H2,(H,9,10);1H |
5-Aminobenzimidazole - Physico-chemical Properties
| Molecular Formula | C7H7N3 |
| Molar Mass | 133.15 |
| Melting Point | 95-113°C |
| Boling Point | 476.1°C at 760 mmHg |
| Flash Point | 273.2°C |
| Vapor Presure | 3.15E-09mmHg at 25°C |
| Storage Condition | Inert atmosphere,Room Temperature |
5-Aminobenzimidazole - Risk and Safety
| Hazard Class | IRRITANT |
5-Aminobenzimidazole - Introduction
5-Aminobenzimidazole(5-Aminobenzimidazole) is an organic compound with the chemical formula C7H7N3. It has the morphology of white to pale yellow crystals.
The following are the properties of 5-Aminobenzimidazole:
1. melting point: 218-220 ℃;
2. Boiling point: 363.5 ℃;
3. Density: 1.38g/cm3;
4. Soluble in water and most organic solvents.
5-Aminobenzimidazole is widely used in chemical synthesis and drug research, and its main uses are as follows:
1. as an intermediate in organic synthesis, used in the synthesis of a variety of organic compounds;
2. In the field of drugs for the synthesis of anti-tumor, anti-cancer and anti-viral drugs;
3. for the study of enzymatic reaction, nucleic acid and protein fluorescence staining.
Preparation of 5-Aminobenzimidazole:
5-Aminobenzimidazole can be prepared by the reaction of phenylenediamine and diethyl carbonate as follows:
1. the reaction of phenylenediamine and diethyl carbonate is carried out under suitable temperature and solvent conditions;
2. gently heat the reaction mixture to promote the reaction;
3. Separation by filtration or crystallization gives pure 5-Aminobenzimidazole.
Safety Information:
The following safety precautions are required when using and handling 5-Aminobenzimidazole:
1. Avoid contact with skin and eyes. For accidental contact, rinse immediately with plenty of water for 15 minutes and seek medical help;
2. avoid inhaling its powder or gas. The operation should be carried out in a well-ventilated place, wearing protective gloves and masks;
3. storage should avoid high temperature, fire and strong light exposure.
The following are the properties of 5-Aminobenzimidazole:
1. melting point: 218-220 ℃;
2. Boiling point: 363.5 ℃;
3. Density: 1.38g/cm3;
4. Soluble in water and most organic solvents.
5-Aminobenzimidazole is widely used in chemical synthesis and drug research, and its main uses are as follows:
1. as an intermediate in organic synthesis, used in the synthesis of a variety of organic compounds;
2. In the field of drugs for the synthesis of anti-tumor, anti-cancer and anti-viral drugs;
3. for the study of enzymatic reaction, nucleic acid and protein fluorescence staining.
Preparation of 5-Aminobenzimidazole:
5-Aminobenzimidazole can be prepared by the reaction of phenylenediamine and diethyl carbonate as follows:
1. the reaction of phenylenediamine and diethyl carbonate is carried out under suitable temperature and solvent conditions;
2. gently heat the reaction mixture to promote the reaction;
3. Separation by filtration or crystallization gives pure 5-Aminobenzimidazole.
Safety Information:
The following safety precautions are required when using and handling 5-Aminobenzimidazole:
1. Avoid contact with skin and eyes. For accidental contact, rinse immediately with plenty of water for 15 minutes and seek medical help;
2. avoid inhaling its powder or gas. The operation should be carried out in a well-ventilated place, wearing protective gloves and masks;
3. storage should avoid high temperature, fire and strong light exposure.
Last Update：2024-04-09 19:05:50
Supplier List
Spot supply
Product Name: 5-Aminobenzimidazole dihydrochloride Visit Supplier Webpage Request for quotationCAS: 55299-95-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 5-Aminobenzimidazole dihydrochloride Visit Supplier Webpage Request for quotationCAS: 55299-95-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History