5-Benzothiazolecarbonitrile(7CI,9CI)
1,3-benzothiazole-5-carbonitrile
CAS: 58249-57-3
Molecular Formula: C8H4N2S
5-Benzothiazolecarbonitrile(7CI,9CI) - Names and Identifiers
| Name | 1,3-benzothiazole-5-carbonitrile |
| Synonyms | LogP 5-Benzothiazolecarbonitrile 5-BENZOTHIAZOLECARBONITRILE Benzo[d]thiazole-5-carbonitrile 1,3-Benzothiazole-5-carbonitrile 1,3-benzothiazole-5-carbonitrile 5-Benzothiazolecarbonitrile(7CI,9CI) |
| CAS | 58249-57-3 |
| InChI | InChI=1/C8H4N2S/c9-4-6-1-2-8-7(3-6)10-5-11-8/h1-3,5H |
5-Benzothiazolecarbonitrile(7CI,9CI) - Physico-chemical Properties
| Molecular Formula | C8H4N2S |
| Molar Mass | 160.2 |
| Density | 1.36±0.1 g/cm3(Predicted) |
| Melting Point | 138-140 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
| Boling Point | 321.4±15.0 °C(Predicted) |
| Flash Point | 148.191°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | -0.60±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.69 |
5-Benzothiazolecarbonitrile(7CI,9CI) - Introduction
1, (1, is), also known as BT-CN, an organic compound with the chemical formula C9H4N2S.
Its main properties include:
1. Appearance: White crystalline solid.
2. Melting point: about 176-178°C.
3. Boiling point: about 438°C.
4. density: about 1.43g/cm3.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl ether and benzene.
1, has a wide range of applications:
1. organic synthesis: can be used as an intermediate or starting material in organic synthesis.
2. Chemicals: can be used to synthesize biologically active compounds, such as drugs, pesticides and dyes.
3. fungicides: can be used to develop new fungicides and antibacterial drugs.
1, there are several main preparation methods:
1. Chemical synthesis: usually prepared by the reaction of benzothiazolone with cyanide.
2. thiazole activation: the use of thiazole on the activation group for substitution reaction, the preparation of the corresponding product.
Regarding safety information, 1, has not been fully evaluated. Please read the relevant safety data sheet carefully before use, wear personal protective equipment correctly, and comply with laboratory operating regulations. Avoid direct contact with the skin and inhalation, try to avoid it into the eyes or ingestion. Appropriate laboratory safety measures and waste disposal methods should be taken when handling this compound.
Its main properties include:
1. Appearance: White crystalline solid.
2. Melting point: about 176-178°C.
3. Boiling point: about 438°C.
4. density: about 1.43g/cm3.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl ether and benzene.
1, has a wide range of applications:
1. organic synthesis: can be used as an intermediate or starting material in organic synthesis.
2. Chemicals: can be used to synthesize biologically active compounds, such as drugs, pesticides and dyes.
3. fungicides: can be used to develop new fungicides and antibacterial drugs.
1, there are several main preparation methods:
1. Chemical synthesis: usually prepared by the reaction of benzothiazolone with cyanide.
2. thiazole activation: the use of thiazole on the activation group for substitution reaction, the preparation of the corresponding product.
Regarding safety information, 1, has not been fully evaluated. Please read the relevant safety data sheet carefully before use, wear personal protective equipment correctly, and comply with laboratory operating regulations. Avoid direct contact with the skin and inhalation, try to avoid it into the eyes or ingestion. Appropriate laboratory safety measures and waste disposal methods should be taken when handling this compound.
Last Update：2024-04-09 20:02:46
Supplier List
Product Name: 5-BENZOTHIAZOLECARBONITRILE Visit Supplier Webpage Request for quotation
CAS: 58249-57-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 58249-57-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-BENZOTHIAZOLECARBONITRILE Visit Supplier Webpage Request for quotation
CAS: 58249-57-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 58249-57-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History