5-Methylhexan-1-ol
5-methyl-1-hexanol
CAS: 627-98-5;51774-11-9
Molecular Formula: C7H16O
5-Methylhexan-1-ol - Names and Identifiers
| Name | 5-methyl-1-hexanol |
| Synonyms | isoheptan-1-ol 5-METHYLHEXANOL ISOHEPTYL ALCOHOL 5-Methylhexan-1-ol 5-methyl-1-hexanol 5-METHYL-1-HEXANOL 5-methylhexan-1-ol 1-Hexanol, 5-methyl- Isometheptene Impurity B 2-butyl-5-methyl-hexanoic acid 3-hydroxy-7-methyloctanoic acid |
| CAS | 627-98-5 51774-11-9 |
| EINECS | 211-023-2 |
| InChI | InChI=1S/C7H16O/c1-7(2)5-3-4-6-8/h7-8H,3-6H2,1-2H3 |
5-Methylhexan-1-ol - Physico-chemical Properties
| Molecular Formula | C7H16O |
| Molar Mass | 116.2 |
| Density | 0.823 g/mL at 25 °C (lit.) |
| Melting Point | -30.45°C (estimate) |
| Boling Point | 167-168 °C (lit.) |
| Flash Point | 165°F |
| Vapor Presure | 0.792mmHg at 25°C |
| pKa | 15.20±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.422(lit.) |
5-Methylhexan-1-ol - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R22 - Harmful if swallowed R38 - Irritating to the skin |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
5-Methylhexan-1-ol - Introduction
5-methyl-1-hexanol(5-methyl-1-hexanol) is an organic compound with the chemical formula C7H16O. It is a colorless liquid with aromatic and alcoholic odors.
The following are some of the properties of 5-methyll-1-hexanol:
1. density: about 0.82 g/cm.
2. Boiling point: about 156-159°C.
3. Melting point: about -31°C.
4. solubility: soluble in general organic solvents, such as ethanol, ether and benzene.
5-methyl-1-hexanol is widely used in various fields and has the following uses:
1. Industrial use: used as an intermediate in organic synthesis, can be used to synthesize other compounds, such as the production of partial hexyl esters.
2. spice industry: commonly used in food and perfume spices to add, give the product a specific flavor.
3. cosmetics industry: as the ingredients of cosmetics, can be used for oil control, antibacterial and other effects.
4. drug synthesis: in organic synthesis, 5-methyl-1-hexanol can also be used to synthesize certain drugs.
Methods for preparing 5-methyll-1-hexanol include the following:
1. Synthesis reaction: 5-methyl-1-hexanol can be prepared by the reaction of 1-hexyne and methyl magnesium iodide.
2. reduction reaction: it can be prepared by the reduction reaction of corresponding aldehyde, ketone or carboxylic acid.
Some safety information to note when using and handling 5-methyll-1-hexanol:
1. 5-methyl-1-hexanol is a flammable liquid and should be kept away from fire and high temperature.
2. use should wear appropriate protective gloves and protective glasses, avoid contact with skin and eyes.
3. Avoid inhaling its vapor or spray, and operate in a well-ventilated place.
4. if accidentally contact with skin or eyes, should immediately rinse with plenty of water, and medical examination.
5. in storage should avoid contact with oxidants, acids and other substances, so as to avoid dangerous reaction.
6. Please store it properly and place it out of the reach of children.
This information is of a general nature and safety and its use and handling in specific cases will be determined by specific experiments and applications.
The following are some of the properties of 5-methyll-1-hexanol:
1. density: about 0.82 g/cm.
2. Boiling point: about 156-159°C.
3. Melting point: about -31°C.
4. solubility: soluble in general organic solvents, such as ethanol, ether and benzene.
5-methyl-1-hexanol is widely used in various fields and has the following uses:
1. Industrial use: used as an intermediate in organic synthesis, can be used to synthesize other compounds, such as the production of partial hexyl esters.
2. spice industry: commonly used in food and perfume spices to add, give the product a specific flavor.
3. cosmetics industry: as the ingredients of cosmetics, can be used for oil control, antibacterial and other effects.
4. drug synthesis: in organic synthesis, 5-methyl-1-hexanol can also be used to synthesize certain drugs.
Methods for preparing 5-methyll-1-hexanol include the following:
1. Synthesis reaction: 5-methyl-1-hexanol can be prepared by the reaction of 1-hexyne and methyl magnesium iodide.
2. reduction reaction: it can be prepared by the reduction reaction of corresponding aldehyde, ketone or carboxylic acid.
Some safety information to note when using and handling 5-methyll-1-hexanol:
1. 5-methyl-1-hexanol is a flammable liquid and should be kept away from fire and high temperature.
2. use should wear appropriate protective gloves and protective glasses, avoid contact with skin and eyes.
3. Avoid inhaling its vapor or spray, and operate in a well-ventilated place.
4. if accidentally contact with skin or eyes, should immediately rinse with plenty of water, and medical examination.
5. in storage should avoid contact with oxidants, acids and other substances, so as to avoid dangerous reaction.
6. Please store it properly and place it out of the reach of children.
This information is of a general nature and safety and its use and handling in specific cases will be determined by specific experiments and applications.
Last Update：2024-04-09 21:21:28
Supplier List
Product Name: 5-Methylhexan-1-ol Visit Supplier Webpage Request for quotation
CAS: 627-98-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 627-98-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-Methylhexan-1-ol Visit Supplier Webpage Request for quotation
CAS: 627-98-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 627-98-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History