5-broMo-4-Methylpyridine-2
5-bromo-4-methylpyridine-2,3-diamine
CAS: 41230-93-7
Molecular Formula: C6H8BrN3
5-broMo-4-Methylpyridine-2 - Names and Identifiers
| Name | 5-bromo-4-methylpyridine-2,3-diamine |
| Synonyms | 5-broMo-4-Methylpyridine-2 5-bromo-4-methyl-2,3-Pyridinediamine 2,3-diamino-5-bromo-4-methylpyridine 5-bromo-4-methylpyridine-2,3-diamine 5-Bromo-2,3-diamino-4-methylpyridine 5-Bromo-4-methylpyridine-2,3-diamine 2,3-Diamine-4-methyl-5-bromopyridine 5-BROMO-4-METHYL-PYRIDINE-2,3-DIAMINE 2,3-pyridinediamine, 5-bromo-4-methyl- 2,3-Pyridinediamine, 5-bromo-4-methyl- |
| CAS | 41230-93-7 |
| EINECS | 145-896-5 |
| InChI | InChI=1/C6H8BrN3/c1-3-4(7)2-10-6(9)5(3)8/h2H,8H2,1H3,(H2,9,10) |
5-broMo-4-Methylpyridine-2 - Physico-chemical Properties
| Molecular Formula | C6H8BrN3 |
| Molar Mass | 202.05 |
| Density | 1.688±0.06 g/cm3(Predicted) |
| Melting Point | 161-162℃ |
| Boling Point | 331.2±37.0 °C(Predicted) |
| Flash Point | 154.118°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 5.16±0.50(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | IRRITANT |
| Refractive Index | 1.682 |
| MDL | MFCD08062974 |
5-broMo-4-Methylpyridine-2 - Introduction
3-diamine is an organic compound with the chemical formula C6H7BrN4. It has the following properties:
1. appearance: 3-diamine is a solid, common is a white crystal or light yellow solid.
2. Solubility: Its solubility in water is low, but it can be dissolved in many organic solvents.
3. Melting point: According to different crystal forms, its melting point range is 70-75°C.
4. Stability: It is relatively stable at room temperature, but may be sensitive to light, heat and oxygen.
, 3-diamine can be used in various chemical synthesis reactions and important intermediates in organic synthesis. It is also widely used in the field of pharmaceutical research and other organic synthesis processes. Specific uses include:
1. Intermediate: As an intermediate in organic synthesis, it can be used to synthesize a variety of target compounds, such as drugs, coatings, dyes, etc.
2. Catalyst: It can be used as a catalyst for certain catalytic reactions.
3. heterocyclic compounds: it can be used for the synthesis of polycyclic aromatic compounds.
A common method for preparing 3-diamine is by bromination of 2,3-diamino-5-methylpyridine (2,3-diamino-5-methylpyridine). The bromination reaction can be carried out using bromine water or a bromoalkane compound, and the target product can be obtained by appropriate extraction and purification steps.
Regarding the safety information of 3-diamine, due to the different characteristics and uses of chemicals, there may be different risks and safety measures. The following safety precautions are therefore recommended when using and handling this compound:
1. avoid direct contact: avoid skin contact, inhalation or ingestion of the substance. Wear appropriate personal protective equipment such as gloves, glasses and protective clothing during handling.
2. avoid fire and high temperature: 3-diamine may decompose at high temperature to produce harmful gases or flammable substances, so it should be away from fire and high temperature.
3. Good ventilation conditions: When handling and using the substance, ensure that the operating place is well ventilated to avoid the accumulation of harmful gases.
4. Storage and disposal: When storing substances, appropriate measures should be taken to ensure their safety. Outdated or discarded materials should be safely disposed of in accordance with local environmental regulations.
Before using this compound, please read and follow the relevant safety data sheet (SDS) and product instructions, and consult a professional if necessary.
1. appearance: 3-diamine is a solid, common is a white crystal or light yellow solid.
2. Solubility: Its solubility in water is low, but it can be dissolved in many organic solvents.
3. Melting point: According to different crystal forms, its melting point range is 70-75°C.
4. Stability: It is relatively stable at room temperature, but may be sensitive to light, heat and oxygen.
, 3-diamine can be used in various chemical synthesis reactions and important intermediates in organic synthesis. It is also widely used in the field of pharmaceutical research and other organic synthesis processes. Specific uses include:
1. Intermediate: As an intermediate in organic synthesis, it can be used to synthesize a variety of target compounds, such as drugs, coatings, dyes, etc.
2. Catalyst: It can be used as a catalyst for certain catalytic reactions.
3. heterocyclic compounds: it can be used for the synthesis of polycyclic aromatic compounds.
A common method for preparing 3-diamine is by bromination of 2,3-diamino-5-methylpyridine (2,3-diamino-5-methylpyridine). The bromination reaction can be carried out using bromine water or a bromoalkane compound, and the target product can be obtained by appropriate extraction and purification steps.
Regarding the safety information of 3-diamine, due to the different characteristics and uses of chemicals, there may be different risks and safety measures. The following safety precautions are therefore recommended when using and handling this compound:
1. avoid direct contact: avoid skin contact, inhalation or ingestion of the substance. Wear appropriate personal protective equipment such as gloves, glasses and protective clothing during handling.
2. avoid fire and high temperature: 3-diamine may decompose at high temperature to produce harmful gases or flammable substances, so it should be away from fire and high temperature.
3. Good ventilation conditions: When handling and using the substance, ensure that the operating place is well ventilated to avoid the accumulation of harmful gases.
4. Storage and disposal: When storing substances, appropriate measures should be taken to ensure their safety. Outdated or discarded materials should be safely disposed of in accordance with local environmental regulations.
Before using this compound, please read and follow the relevant safety data sheet (SDS) and product instructions, and consult a professional if necessary.
Last Update：2024-04-09 21:54:55
