5-chloro-2-methyl-1,3-benzoxazol-6-amine

5-chloro-2-methyl-1,3-benzoxazol-6-amine - Names and Identifiers

Name	2-Methyl-5-chloro-6-benzoxazolamine
Synonyms	2-METHYL-5-CHLORO-6-BENZOXAZOLAMINE 2-Methyl-5-chloro-6-benzoxazolamine 2-Methyl-5-chloro-6-aminobenzoxazole 2-methyl-5-ch1oro-6-benzoxazo lamine 6-AMINO-5-CHLORO-2-METHYLBENZOXAZOLE 6-Benzoxazolamine, 5-chloro-2-methyl- 6-benzoxazolamine, 5-chloro-2-methyl- 5-Chlor-2-methyl-1,3-benzoxazol-6-amin 5-chloro-2-methyl-1,3-benzoxazol-6-amine 5-Chloro-2-methyl-1,3-benzoxazol-6-amine
CAS	323579-00-6
InChI	InChI=1/C8H7ClN2O/c1-4-11-7-2-5(9)6(10)3-8(7)12-4/h2-3H,10H2,1H3

5-chloro-2-methyl-1,3-benzoxazol-6-amine - Physico-chemical Properties

Molecular Formula	C8H7ClN2O
Molar Mass	182.61
Density	1.403±0.06 g/cm3(Predicted)
Melting Point	202-203 °C
Boling Point	306.2±22.0 °C(Predicted)
Flash Point	139°C
Vapor Presure	0.000783mmHg at 25°C
pKa	1.10±0.10(Predicted)
Storage Condition	2-8 ℃, dark
Refractive Index	1.667

5-chloro-2-methyl-1,3-benzoxazol-6-amine - Introduction

It is an organic compound with the chemical formula C8H7ClN2O.

Its main properties include:
1. Appearance: white crystalline solid.
2. Melting Point: about 125 - 127 ℃.
3. Solubility: slightly soluble in water, soluble in alcohol and ether solvents.
4. Chemical reaction: a series of organic reactions can occur, such as substitution reaction, ring reaction, etc.

Its main uses are:
1. Pesticide: as an organic synthesis intermediate, it can be used to synthesize pesticides, such as insecticides, fungicides, etc.
2. Drugs: can be used as drug intermediates, involved in the synthesis of certain drugs.

The preparation method can be carried out through the following steps:
1. Obtaining 2-Aminophenol.
2. Under appropriate conditions, 2-aminophenol and proper amount of thionyl chloride (SOCl2) are reacted to obtain 2-amino -5-chlorophenyl phenol (2-Amino-5-chlorophenol).
3. Under appropriate conditions, 2-amino -5-chlorophenyl phenol and methylating reagent are reacted to obtain the target product.

Regarding safety information, you need to pay attention to the following points:
1. The compound may be irritating to the eyes and skin, and attention should be paid to avoid contact during operation.
2. During use, avoid inhaling its dust or vapor, and ensure that it is operated in a well-ventilated place.
3. Avoid contact with strong oxidants and strong acids to avoid dangerous reactions.
4. In the storage process, should be away from the fire and heat source, stored in a cool, dry place.

Last Update：2024-04-09 21:00:56