50827-57-1
2-hydroxymethyl-6-methoxy-1,4-benzoquinone
CAS: 50827-57-1
Molecular Formula: C8H8O4
50827-57-1 - Names and Identifiers
| Name | 2-hydroxymethyl-6-methoxy-1,4-benzoquinone |
| Synonyms | Nsc271291 Aids031156 Aids-031156 2-hydroxymethyl-6-methoxy-1,4-benzoquinone 2-HYDROXYMETHYL-6-METHOXY-1,4-BENZOQUINONE 2-(Hydroxymethyl)-6-methoxy-p-benzoquinone 2,5-Cyclohexadiene-1,4-dione, 2-(hydroxymethyl)-6-methoxy- |
| CAS | 50827-57-1 |
| InChI | InChI=1/C8H8O4/c1-12-7-3-6(10)2-5(4-9)8(7)11/h2-3,9H,4H2,1H3 |
50827-57-1 - Physico-chemical Properties
| Molecular Formula | C8H8O4 |
| Molar Mass | 168.15 |
| Density | 1.32g/cm3 |
| Melting Point | 155-157°C(lit.) |
| Boling Point | 343.9°C at 760 mmHg |
| Flash Point | 145°C |
| Vapor Presure | 4.37E-06mmHg at 25°C |
| Refractive Index | 1.541 |
50827-57-1 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
50827-57-1 - Introduction
A, 4-benzoquinone (a, 4-benzoquone) is a compound that has the following properties:
1. Appearance: colorless or light yellow solid
2. Solubility: Soluble in water, alcohol and chloroform
3. Melting point: about 160-162°C
4. Molecular formula: C9H8O4
5. Molecular weight: 180.16g/mol
, 4-benzoquinone has certain uses in some fields, such:
1. Drug research: It has antioxidant and antibacterial properties, so it can be used to develop drugs for the treatment of diseases.
2. Cosmetics: It can be used as an antioxidant in cosmetics to help protect the skin from free radical damage.
3. Dye: It can be used as an intermediate for dye synthesis.
The preparation of 4-benzoquinone is usually carried out by the following steps:
1. p-toluone (p-benzoquinone) and methanol react under alkaline conditions to generate p-toluone alcohol (p-hydroxybenzoquinone).
2. 4-benzoquinone is obtained by oxidizing p-toluoquinone alcohol.
Regarding safety information, 4-benzoquinone should be handled with caution and avoid contact with skin, eyes and inhalation. Wear appropriate protective equipment such as gloves, goggles and protective masks during use. For accidental contact, rinse immediately with plenty of water. If you have persistent discomfort, seek medical help.
1. Appearance: colorless or light yellow solid
2. Solubility: Soluble in water, alcohol and chloroform
3. Melting point: about 160-162°C
4. Molecular formula: C9H8O4
5. Molecular weight: 180.16g/mol
, 4-benzoquinone has certain uses in some fields, such:
1. Drug research: It has antioxidant and antibacterial properties, so it can be used to develop drugs for the treatment of diseases.
2. Cosmetics: It can be used as an antioxidant in cosmetics to help protect the skin from free radical damage.
3. Dye: It can be used as an intermediate for dye synthesis.
The preparation of 4-benzoquinone is usually carried out by the following steps:
1. p-toluone (p-benzoquinone) and methanol react under alkaline conditions to generate p-toluone alcohol (p-hydroxybenzoquinone).
2. 4-benzoquinone is obtained by oxidizing p-toluoquinone alcohol.
Regarding safety information, 4-benzoquinone should be handled with caution and avoid contact with skin, eyes and inhalation. Wear appropriate protective equipment such as gloves, goggles and protective masks during use. For accidental contact, rinse immediately with plenty of water. If you have persistent discomfort, seek medical help.
Last Update：2024-04-09 20:02:46
