517920-70-6
4-bromo-2-fluoro-6-nitroaniline
CAS: 517920-70-6
Molecular Formula: C6H4BrFN2O2
517920-70-6 - Names and Identifiers
| Name | 4-bromo-2-fluoro-6-nitroaniline |
| Synonyms | 2-Fluoro-4-bromo-6-nitroaniline 4-bromo-2-fluoro-6-nitroaniline 2-Fluoro-4-Bromo-6-Nitroaniline 4-Bromo-2-fluoro-6-nitrobenzenamine 4-Bromo-2-fluoro-6-nitro-phenylamine 2-Amino-5-bromo-3-fluoronitrobenzene Benzenamine, 4-bromo-2-fluoro-6-nitro- |
| CAS | 517920-70-6 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C6H4BrFN2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 |
517920-70-6 - Physico-chemical Properties
| Molecular Formula | C6H4BrFN2O2 |
| Molar Mass | 235.01 |
| Density | 1.896±0.06 g/cm3(Predicted) |
| Boling Point | 292.1±35.0 °C(Predicted) |
| Flash Point | 130.5°C |
| Vapor Presure | 0.00187mmHg at 25°C |
| pKa | -2.54±0.25(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,2-8°C |
| Refractive Index | 1.641 |
517920-70-6 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
517920-70-6 - Introduction
It is an organic compound with the chemical formula C6H4BrFN2O2. Its nature is as follows:
1. Appearance: It is a yellow crystal or crystalline powder.
2. solubility: soluble in alcohol, chlorinated hydrocarbon and ester solvents, insoluble in water.
3. melting point: about 110-113 ℃.
4. Use and application: It is commonly used in organic synthesis, for example, as a dye, fluorescent probe, biological marker, etc. It can also be used to prepare additives for rubber and plastics.
5. preparation method: it can be prepared by the chemical reaction of p-nitroaniline. first, bromine atom is introduced into the molecule of nitroaniline, and then fluorination reaction is carried out.
6. safety information: belongs to organic compounds, irritating to skin and eyes. During use, care should be taken to wear appropriate protective equipment. At the same time, should be away from the fire and avoid inhalation of its dust.
1. Appearance: It is a yellow crystal or crystalline powder.
2. solubility: soluble in alcohol, chlorinated hydrocarbon and ester solvents, insoluble in water.
3. melting point: about 110-113 ℃.
4. Use and application: It is commonly used in organic synthesis, for example, as a dye, fluorescent probe, biological marker, etc. It can also be used to prepare additives for rubber and plastics.
5. preparation method: it can be prepared by the chemical reaction of p-nitroaniline. first, bromine atom is introduced into the molecule of nitroaniline, and then fluorination reaction is carried out.
6. safety information: belongs to organic compounds, irritating to skin and eyes. During use, care should be taken to wear appropriate protective equipment. At the same time, should be away from the fire and avoid inhalation of its dust.
Last Update：2024-04-10 22:29:15
