52204-65-6
4-propylcyclohexan-1-ol
CAS: 52204-65-6
Molecular Formula: C9H18O
52204-65-6 - Names and Identifiers
| Name | 4-propylcyclohexan-1-ol |
| Synonyms | 4-Propylcyclohexanol 4-propylcyclohexanol 4-PROPYLCYCLOHEXANOL 4-n-Propylcyclohexanol 4-PROPYLCYCLOHEXAN-1-OL 4-propylcyclohexan-1-ol 1-Hydroxy-4-propylcyclohexane 4-Propylcyclohexanol (cis- and trans- mixture) 4-([trans(trans)]-4'-butyl-[1,1'-bicyclohexyl]-4-yl)-1-iodo-Benzene |
| CAS | 52204-65-6 |
| InChI | InChI=1/C9H18O/c1-2-3-8-4-6-9(10)7-5-8/h8-10H,2-7H2,1H3 |
52204-65-6 - Physico-chemical Properties
| Molecular Formula | C9H18O |
| Molar Mass | 142.24 |
| Density | 0.9072 g/cm3(Temp: 17 °C) |
| Boling Point | 92-93 °C |
| Flash Point | 80.2°C |
| Vapor Presure | 0.0737mmHg at 25°C |
| pKa | 15.32±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4630-1.4670 |
52204-65-6 - Introduction
4-propylcyclohexan-1-ol is an organic compound with the chemical formula C9H18O. The following is a description of its nature, use, formulation and safety information:
1. nature:
-Appearance: 4-propylcyclohexan-1-ol is a colorless to light yellow liquid.
-Odor: Has a special smell.
-Density: Approximately 0.853 g/mL.
-Melting point: about -52 ℃.
-Boiling point: about 209-210 ℃.
-Solubility: Soluble in organic solvents such as ethanol and dichloromethane.
2. use:
- 4-propylcyclohexan-1-ol is commonly used in the synthesis of chemicals, such as fragrances and pharmaceuticals.
-It can also be used as a solvent for applications such as inks and coatings.
3. Preparation method:
- 4-propylcyclohexan-1-ol can be obtained by the reaction of cyclohexene and n-propanol in the presence of an acidic catalyst.
4. Safety Information:
- 4-propylcyclohexan-1-ol is a flammable liquid and should be kept away from fire and high temperature.
-Wear appropriate personal protective equipment, such as gloves and goggles.
-Avoid prolonged exposure to skin and eyes to avoid irritation.
-If inhaled or exposed to the compound, wash and dispose of it immediately. If there is discomfort or unknown symptoms, should be timely medical treatment.
1. nature:
-Appearance: 4-propylcyclohexan-1-ol is a colorless to light yellow liquid.
-Odor: Has a special smell.
-Density: Approximately 0.853 g/mL.
-Melting point: about -52 ℃.
-Boiling point: about 209-210 ℃.
-Solubility: Soluble in organic solvents such as ethanol and dichloromethane.
2. use:
- 4-propylcyclohexan-1-ol is commonly used in the synthesis of chemicals, such as fragrances and pharmaceuticals.
-It can also be used as a solvent for applications such as inks and coatings.
3. Preparation method:
- 4-propylcyclohexan-1-ol can be obtained by the reaction of cyclohexene and n-propanol in the presence of an acidic catalyst.
4. Safety Information:
- 4-propylcyclohexan-1-ol is a flammable liquid and should be kept away from fire and high temperature.
-Wear appropriate personal protective equipment, such as gloves and goggles.
-Avoid prolonged exposure to skin and eyes to avoid irritation.
-If inhaled or exposed to the compound, wash and dispose of it immediately. If there is discomfort or unknown symptoms, should be timely medical treatment.
Last Update：2024-04-09 02:00:46
Supplier List
Product Name: 4-Propylcyclohexan-1-ol Visit Supplier Webpage Request for quotation
CAS: 52204-65-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 52204-65-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-Propylcyclohexan-1-ol Visit Supplier Webpage Request for quotation
CAS: 52204-65-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 52204-65-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History