54930-39-1
3-(4-methylphenyl)propan-1-amine
CAS: 54930-39-1
Molecular Formula: C10H15N
54930-39-1 - Names and Identifiers
| Name | 3-(4-methylphenyl)propan-1-amine |
| Synonyms | LogP OTAVA-BB 1038710 UKRORGSYN-BB BBV-182394 4-Methyl-benzenepropanamine 4-Methyl-benzenepropanaMine benzenepropanamine, 4-methyl- Benzenepropanamine, 4-methyl- 3-(4-methylphenyl)propylamine [3-(4-methylphenyl)propyl]amine 3-(4-methylphenyl)propan-1-amine |
| CAS | 54930-39-1 |
| InChI | InChI=1/C10H15N/c1-9-4-6-10(7-5-9)3-2-8-11/h4-7H,2-3,8,11H2,1H3 |
54930-39-1 - Physico-chemical Properties
| Molecular Formula | C10H15N |
| Molar Mass | 149.23 |
| Density | 0.94g/cm3 |
| Boling Point | 239.219°C at 760 mmHg |
| Flash Point | 103.403°C |
| Vapor Presure | 0.041mmHg at 25°C |
| Refractive Index | 1.527 |
54930-39-1 - Risk and Safety
| WGK Germany | 3 |
