55186-89-5
1-Benzyl-1,4-diazepan-5-one
CAS: 55186-89-5
Molecular Formula: C12H16N2O
55186-89-5 - Names and Identifiers
| Name | 1-Benzyl-1,4-diazepan-5-one |
| Synonyms | NSC45105 1-Benzyl-1,4-diazepan-5-one 1-Benzylhomopiperazin-5-one 1-Benzyl-1,4-diazepin-5-one 1-Benzyl-[1,4]diazepan-5-one 1-Benzyl-5-oxo-1,4-diazepane 1-(phenylmethyl)-1,4-diazepan-5-one 5H-1,4-Diazepin-5-one, hexahydro-1-(phenylmethyl)- 1-Benzyl-2,3,6,7-tetrahydro-(1H)-1,4-diazepin-5(4H)-one |
| CAS | 55186-89-5 |
| InChI | InChI=1/C12H16N2O/c15-12-6-8-14(9-7-13-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,13,15) |
55186-89-5 - Physico-chemical Properties
| Molecular Formula | C12H16N2O |
| Molar Mass | 204.27 |
| Density | 1.097±0.06 g/cm3(Predicted) |
| Melting Point | 115-117° |
| Boling Point | 379.8±35.0 °C(Predicted) |
| Flash Point | 183.507°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 16.00±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.55 |
55186-89-5 - Introduction
1-Benzyl-1,4-diazepan-5-one is an organic compound containing a benzyl group and a 1,4-diazepyl group in its chemical structure, and a ketone group at the 5th position.
Properties of the compound include:
1. appearance: common white crystal or solid.
2. Solubility: Soluble in many organic solvents, such as chloroform, methanol and ethanol, but insoluble in water.
1-Benzyl-1,4-diazepan-5-one has certain applications in the field of medicine:
1. Anxiolytics: The compound is used as a drug for the treatment of anxiety and sleep disorders.
Preparation Method:
1-Benzyl-1,4-diazepan-5-one can be obtained by the reaction of dioxane (1,4,7,10-tetraoxabicyclotetradecanoic acid anhydride) and benzylamine. During the reaction, nucleophilic substitution of benzylamine and dioxane occurs to generate the target product.
Regarding safety information, due to the different regulations and standards in each country and region, it is recommended to consult the relevant official literature or professional bodies for detailed safety information and operating guidelines before using or handling the compound.
Properties of the compound include:
1. appearance: common white crystal or solid.
2. Solubility: Soluble in many organic solvents, such as chloroform, methanol and ethanol, but insoluble in water.
1-Benzyl-1,4-diazepan-5-one has certain applications in the field of medicine:
1. Anxiolytics: The compound is used as a drug for the treatment of anxiety and sleep disorders.
Preparation Method:
1-Benzyl-1,4-diazepan-5-one can be obtained by the reaction of dioxane (1,4,7,10-tetraoxabicyclotetradecanoic acid anhydride) and benzylamine. During the reaction, nucleophilic substitution of benzylamine and dioxane occurs to generate the target product.
Regarding safety information, due to the different regulations and standards in each country and region, it is recommended to consult the relevant official literature or professional bodies for detailed safety information and operating guidelines before using or handling the compound.
Last Update：2024-04-09 18:58:34
Supplier List
Product Name: 1-Benzyl-1,4-diazepan-5-one Visit Supplier Webpage Request for quotation
CAS: 55186-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 55186-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 1-Benzyl-1,4-diazepan-5-one Visit Supplier Webpage Request for quotation
CAS: 55186-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 55186-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History