55489-15-1 - Names and Identifiers
Name | 5-Ethoxy-2-Mercaptobenzimidazole
|
Synonyms | 5-ETHOXY-2-BENZIMIDAZOLETHIOL 5-Ethoxybenzimidazole-2-thiol 5-Ethoxy-2-Mercaptobenzimidazole 5-ETHOXY-2-MERCAPTOBENZIMIDAZOLE 5-ETHOXY-1H-BENZIMIDAZOLE-2-THIOL 5-ethoxy-1H-1,3-benzodiazole-2-thiol 5-ethoxy-1,7a-dihydrobenzimidazole-2-thione 5-ethoxy-1,3-dihydro-2H-benzimidazole-2-thione 2H-Benzimidazole-2-thione,5-ethoxy-1,3-dihydro-(9CI)
|
CAS | 55489-15-1
|
EINECS | 611-274-1 |
InChI | InChI=1/C9H10N2OS/c1-2-12-6-3-4-7-8(5-6)11-9(13)10-7/h3-5H,2H2,1H3,(H2,10,11,13) |
55489-15-1 - Physico-chemical Properties
Molecular Formula | C9H10N2OS
|
Molar Mass | 194.25 |
Density | 1.32 |
Melting Point | 252-256°C(lit.) |
Boling Point | 321.5±44.0 °C(Predicted) |
Flash Point | 148.2°C |
Vapor Presure | 0.000297mmHg at 25°C |
Appearance | powder to crystal |
Color | Light yellow to Yellow to Orange |
BRN | 4310013 |
pKa | 10.16±0.30(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.668 |
MDL | MFCD01326487 |
55489-15-1 - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
UN IDs | UN 3335 |
WGK Germany | 3 |
HS Code | 29332900 |
55489-15-1 - Introduction
It is an organic compound with a chemical formula of C10H10N2O and a molecular weight of 174.20g/mol. It has a white to yellowish crystalline solid or powdery substance.
Nature:
1. Appearance: White to light yellow crystalline solid or powdery substance.
2. melting point: about 130-133 degrees Celsius.
3. Insoluble in water, but soluble in alcohol, ether and ketone and other organic solvents.
Use:
Many uses in chemistry and medicine include:
1. As an intermediate in organic synthesis, it is widely used in the synthesis of biologically active compounds.
2. additives for metal corrosion inhibitors and anti-rust coatings.
3. Used as an antioxidant for rubber and plastics.
Preparation Method:
The preparation of Bing can be achieved through the following steps:
1. obtain p-nitroaniline and react it with ether (such as ether solvent) and appropriate amount of sulfuric acid sulfonyl chloride to generate sulfuric acid ester.
2. A nucleophilic substitution reaction is carried out by adding a nucleophilic reagent, mercaptoformic acid, to the obtained sulfated product.
3. Finally, the target product was purified by alkali treatment and crystallization.
Safety Information:
The specific safety information about the pill may vary. It is recommended to follow the following general safety measures during use:
1. Avoid direct contact with skin, eyes and respiratory tract. In case of accidental contact, rinse immediately with water.
2. during use, should be equipped with appropriate protective measures, such as laboratory gloves, protective glasses and protective masks.
3. Avoid inhaling dust or vapors of the substance. If inhaled, should quickly leave the contaminated area, keep the respiratory tract unobstructed.
4. storage, should be stored in a dry, cool place, away from fire and oxidant.
Last Update:2024-04-09 21:00:56