55844-94-5
Merrifield Resin
CAS: 55844-94-5
Molecular Formula: C40H32N3O3R
55844-94-5 - Names and Identifiers
| Name | Merrifield Resin |
| Synonyms | styrene PL-CMS RESIN PL-CMS MP-RESIN MERRIFIELD RESIN Merrifield Resin 1,4-divinylbenzene 4-CHLOROMETHYL RESIN 4-CHLOROMETHYL PS RESIN STRATOSPHERES(TM) PL-CMS RESIN 4-CHLOROMETHYL POLYSTYRENE RESIN 1-(chloromethyl)-4-vinyl-benzene ULTRASUBSTITUTED MERRIFIELD RESIN POLY(STYRENE-CO-CHLOROMETHYLSTYRENE) Chloromethylstyrene-Divinylbenzene-Styrene Copolymer |
| CAS | 55844-94-5 |
| EINECS | 000-000-0 |
| InChI | InChI=1/C10H10.C9H9Cl.C8H8/c1-3-9-5-7-10(4-2)8-6-9;1-2-8-3-5-9(7-10)6-4-8;1-2-8-6-4-3-5-7-8/h3-8H,1-2H2;2-6H,1,7H2;2-7H,1H2 |
55844-94-5 - Physico-chemical Properties
| Molecular Formula | C40H32N3O3R |
| Molar Mass | 602.70038 |
| Boling Point | 536.1°C at 760 mmHg |
| Flash Point | 250.2°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 5.01E-11mmHg at 25°C |
| Appearance | porous |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4385 |
55844-94-5 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| HS Code | 39039000 |
55844-94-5 - Introduction
Merrifield Resin, also known as Merrifield resin (Merrifield resin), is a polymer resin used in chemical synthesis and solid phase synthesis. It is a strong acid and alkali resistant directional link resin, usually made of polyethylene or polystyrene matrix. The following is an introduction to some of the features, uses, methods, and safety information about Merrifield Resin:
Nature:
1. Merrifield Resin has a large specific surface area and pore structure, which can provide high carrier efficiency.
2. It has good chemical stability and can be used in a wide range of solvents and reaction conditions.
3. Merrifield Resin has highly oriented functional groups and can be covalently bonded with compounds.
Use:
1. Merrifield Resin is usually used in solid phase synthesis to synthesize compounds with specific structures.
2. It is also widely used in stationary phase chromatography for the separation and purification of compounds.
3. Merrifield Resin can also be used to immobilize enzymes, antibodies and other biological molecules.
Preparation Method:
The preparation of Merrifield Resin usually includes the following steps:
1. The polymer matrix (such as polyethylene or polystyrene) is functionalized to introduce specific functional groups.
2. The functionalized polymer reacts with a crosslinking agent (such as divinylbenzene) to form a crosslinked network structure.
3. The remaining unreacted functional groups are protected (if necessary).
Safety Information:
1. Merrifield Resin is generally safe, appropriate laboratory procedures should be followed when using it.
2. specific Merrifield Resin may contain specific hazardous chemicals, according to the actual situation to choose the appropriate safety measures.
3. Avoid direct contact with skin and eyes during use, and ensure that the experimental site is well ventilated. In case of accidental contact with skin or eyes, rinse immediately with plenty of water and seek medical help.
Nature:
1. Merrifield Resin has a large specific surface area and pore structure, which can provide high carrier efficiency.
2. It has good chemical stability and can be used in a wide range of solvents and reaction conditions.
3. Merrifield Resin has highly oriented functional groups and can be covalently bonded with compounds.
Use:
1. Merrifield Resin is usually used in solid phase synthesis to synthesize compounds with specific structures.
2. It is also widely used in stationary phase chromatography for the separation and purification of compounds.
3. Merrifield Resin can also be used to immobilize enzymes, antibodies and other biological molecules.
Preparation Method:
The preparation of Merrifield Resin usually includes the following steps:
1. The polymer matrix (such as polyethylene or polystyrene) is functionalized to introduce specific functional groups.
2. The functionalized polymer reacts with a crosslinking agent (such as divinylbenzene) to form a crosslinked network structure.
3. The remaining unreacted functional groups are protected (if necessary).
Safety Information:
1. Merrifield Resin is generally safe, appropriate laboratory procedures should be followed when using it.
2. specific Merrifield Resin may contain specific hazardous chemicals, according to the actual situation to choose the appropriate safety measures.
3. Avoid direct contact with skin and eyes during use, and ensure that the experimental site is well ventilated. In case of accidental contact with skin or eyes, rinse immediately with plenty of water and seek medical help.
Last Update：2024-04-09 15:17:58
Supplier List
Spot supply
Product Name: Chloromethyl Polystyrene Resin Visit Supplier Webpage Request for quotationCAS: 55844-94-5
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: Chloromethyl Polystyrene Resin Visit Supplier Webpage Request for quotationCAS: 55844-94-5
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: Chloromethyl Polystyrene Resin Visit Supplier Webpage Request for quotationCAS: 55844-94-5
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: Chloromethyl Polystyrene Resin Visit Supplier Webpage Request for quotationCAS: 55844-94-5
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
View History
55844-94-5
Chloro(p-cymene)[(1R,2R)-(-)-2-amino-1,2-diphenylethyl(methylsulfonylamido)]ruthenium(II) RuCl(p-cymene)[(R,R)-MsDpen]
Chloro(p-cymene)[(1R,2R)-(-)-2-amino-1,2-diphenylethyl(methylsulfonylamido)]ruthenium(II) RuCl(p-cymene)[(R,R)-MsDpen]