574758-53-5

574758-53-5 - Names and Identifiers

Name	6-Hydroxy-1H-indazole-5-carboxylic acid
Synonyms	6-Hydroxy-1H-indazole-5-carboxylic acid 1H-Indazole-5-carboxylic acid, 6-hydroxy-
CAS	574758-53-5
InChI	InChI=1S/C8H6N2O3/c11-7-2-6-4(3-9-10-6)1-5(7)8(12)13/h1-3,11H,(H,9,10)(H,12,13)

574758-53-5 - Physico-chemical Properties

Molecular Formula	C8H6N2O3
Molar Mass	178.14

574758-53-5 - Introduction

Acid (acid) is an organic compound. Its chemical formula is C9H6N2O3 and its relative molecular mass is 194.15g/mol.

The following are some of the properties of this compound:
1. Appearance: acid exists as a white crystalline solid.
2. Melting point: Its melting point range is 135-137°C.
3. solubility: acid can be dissolved in some polar solvents such as water, methanol and dimethyl sulfoxide.

This compound has some practical uses:
1. Drug research: acid may be used in drug development and manufacturing as the basic structure of active drug molecules.
2. Organic synthesis: It can be used as a starting material or intermediate for organic synthesis.

Regarding its preparation method, acid can be synthesized through some synthetic paths. The specific synthesis methods may vary depending on the research needs, and common synthesis methods include chemical reactions, catalytic reactions, etc.

As for safety information, due to the lack of specific safety assessment data, care needs to be taken when using and handling the compound. Appropriate laboratory safety measures should be taken to avoid contact with skin, eyes, etc., and to avoid inhalation or ingestion. It is necessary to operate in well-ventilated conditions and take personal protective measures, such as wearing protective glasses, gloves and laboratory coats. When using and handling, reference should be made to relevant safety operation standards and data.

Last Update：2024-04-09 21:54:55