5754-34-7 - Names and Identifiers
Name | 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
|
Synonyms | 2-(2,2-Dimethyl-1,3-dioxolan-4-yl) 2,2-dimethyl-1,3-dioxolane-4-ethanol 1,3-Dioxolane-4-ethanol, 2,2-dimethyl- 1,3-Dioxolane-4-ethanol, 2,2-diMethyl- 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane 4-(2-HYDROXYETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE 4-(2-Hydroxyethyl)-2,2-diMethyl-1,3-dioxolaMe (RAC)-2-(2,2-DIMETHYL[1,3]DIOXOLANE-4YL)ETHANOL (Rac)-2-(2,2-Dimethyl[1,3]Dioxolane-4Yl)Ethanol ethyl 7-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
|
CAS | 5754-34-7
|
InChI | InChI=1/C27H28ClNO5/c1-5-34-27(31)24-15(2)29-20-12-18(16-6-9-19(28)10-7-16)13-21(30)26(20)25(24)17-8-11-22(32-3)23(14-17)33-4/h6-11,14,18,25,29H,5,12-13H2,1-4H3 |
5754-34-7 - Physico-chemical Properties
Molecular Formula | C7H14O3
|
Molar Mass | 146.18 |
Density | 1.031g/mLat 25°C(lit.) |
Boling Point | 199-200°C(lit.) |
Flash Point | >230°F |
Vapor Presure | 4.7E-15mmHg at 25°C |
pKa | 14.80±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Refractive Index | n20/D 1.4400(lit.) |
5754-34-7 - Risk and Safety
UN IDs | NA 1993 / PGIII |
WGK Germany | 3 |
5754-34-7 - Introduction
4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane is an organic compound with the chemical formula C7H14O3. The following is a detailed description of its nature, use, formulation and safety information:
Nature:
-Appearance: 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane is a colorless liquid.
-Melting point:-58°C
-Boiling point: 134°C
-Density: 1.026 g/mL
-Solubility: Soluble in water and organic solvents, such as ethanol, chloroform, etc.
Use:
- 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane is commonly used as a solvent, catalyst or reaction intermediate in organic synthesis.
-It can be used to prepare other organic compounds, such as heterocyclic compounds, stereoselective compounds, etc.
Preparation Method:
-4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane can be prepared by the following steps:
1. The reaction of 2,2-dimethyl -1,3-dioxopentone with 2-bromoethanol under alkaline conditions.
2. Hydrolyze the reaction product under acidic conditions to obtain the target product.
Safety Information:
- 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane is less toxic to the human body, but it is still necessary to pay attention to protective measures to avoid contact with skin and eyes.
-Wear appropriate protective equipment such as lab gloves, safety glasses, and lab coats when using and handling this compound.
-In case of contact with skin or eyes, rinse immediately with water and seek medical help.
-When storing and handling this compound, the relevant safety and environmental regulations should be observed.
Last Update:2024-04-10 22:29:15