6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-on - Names and Identifiers
Name | 6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one
|
Synonyms | 6-Bromo-3,4-dihydro-1H-[1,8]naphthyrid-2-one 6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-on 6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one 6-BROMO-3,4-DIHYDRO-1,8-NAPHTHYRIDIN-2(1H)-ONE 6-bioMo-3,4-dihydro-1H-[1,8]naphthyridin-2-one 6-BROMO-3,4-DIHYDRO-1H-[1,8]NAPHTHYRIDIN-2-ONE 1,8-Naphthyridin-2(1H)-one,6-broMo-3,4-dihydro- 6-broMo-1,2,3,4-tetrahydro-1,8-naphthyridin-2-one 6-Bromo-2-oxo-1,2,3,4-tetrahydro-1,8-naphthyridine
|
CAS | 129686-16-4
|
EINECS | 251-156-6 |
InChI | InChI=1/C8H7BrN2O/c9-6-3-5-1-2-7(12)11-8(5)10-4-6/h3-4H,1-2H2,(H,10,11,12) |
6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-on - Physico-chemical Properties
Molecular Formula | C8H7BrN2O
|
Molar Mass | 227.06 |
Density | 1.83±0.1 g/cm3(Predicted) |
Melting Point | 265-267°C |
Boling Point | 300.9±52.0 °C(Predicted) |
Flash Point | 194.625°C |
Solubility | DMSO |
Vapor Presure | 0mmHg at 25°C |
Appearance | off-white to yellow solid |
Color | Off- White to Yellow |
pKa | 2.69±0.20(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.606 |
6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-on - Introduction
6-Bromo-3, 4-dihydro-1H-[1,8] naphthyridin-2-one is an organic compound with the following properties:
1. Appearance: colorless solid.
2. solubility: soluble in organic solvents such as ethanol, ether, low solubility in water.
3. stability: relatively stable at room temperature, but prone to decomposition reaction under heat or light.
4. Reactivity: It is a ketone compound, which can participate in the chemical reactions of ketones, such as reduction, oxidation, acid catalysis and other reactions.
The main uses of this compound include:
1. Chemical synthesis: It can be used as an intermediate in organic synthesis for the synthesis of other complex organic compounds.
2. Drug research: Because it contains a naphthyridine structure, it has potential application value for the study of drugs or drug analogs.
There are various methods for preparing the compound. A common method is to obtain it by the reaction of substituted acetophenone. The specific preparation method needs to be determined according to the specific conditions and the required yield.
Regarding safety information, 6-bromo-3, 4-dihydro-1H-[1,8] naphthyridin-2-one is not significantly toxic to humans and the environment at relatively low concentrations under normal conditions. However, in the process of handling, necessary protective measures should be taken, such as wearing protective gloves and glasses, to avoid inhalation or contact with skin. In addition, the specific toxicology of the compound needs to be further studied. In the process of use and handling, the relevant safety operation procedures and guidelines should be strictly observed.
Last Update:2024-04-09 20:52:54