6-Bromo-4-hydroxy-3-nitroquinoline

6-Bromo-4-hydroxy-3-nitroquinoline - Names and Identifiers

Name	6-bromo-3-nitro-quinolin-4-ol
Synonyms	LogP 6-Brom-3-nitrochinolin-4-ol 6-Bromo-3-nitroquinolin-4-ol 6-BroMo-3-nitro-4-quinoli... 6-Bromo-3-nitro-4-quinolinol 6-BROMO-3-NITROQUINOLIN-5-OL 6-bromo-3-nitro-quinolin-4-ol 6-Bromo-3-nitro-quinolin-4-ol 4-Quinolinol, 6-broMo-3-nitro- 4-Quinolinol, 6-bromo-3-nitro- 6-bromo-3-nitro-1H-quinolin-4-one 6-Bromo-4-hydroxy-3-nitroquinoline 3-Nitro-4-hydroxy-6-broMoquinoline 6-BroMo-3-nitro-4-hydroxy-quinoline
CAS	853908-50-6
InChI	InChI=1/C9H5BrN2O3/c10-5-1-2-7-6(3-5)9(13)8(4-11-7)12(14)15/h1-4H,(H,11,13)

6-Bromo-4-hydroxy-3-nitroquinoline - Physico-chemical Properties

Molecular Formula	C9H5BrN2O3
Molar Mass	269.05
Density	1.878±0.06 g/cm3(Predicted)
Boling Point	389.3±37.0 °C(Predicted)
Flash Point	189.266°C
Vapor Presure	0mmHg at 25°C
pKa	-0.53±0.50(Predicted)
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.749
MDL	MFCD09800413

6-Bromo-4-hydroxy-3-nitroquinoline - Introduction

It is an organic compound with the following properties:

1. Appearance: yellow to orange solid.
2. Solubility: Soluble in organic solvents such as chloroform, dimethyl sulfoxide, etc., insoluble in water.
3. molecular structure: contains a hydroxyl group and a nitro functional group, and a bromine atom, which are connected to a quinoline ring.

This compound is commonly used in medical research and organic synthesis. Specific applications include:

1. Drug activity research: It can be used as a part of the drug molecular skeleton to design and develop compounds with antibacterial, antiviral or anticancer activities.
2. Dye and fluorescent probe: Its structural characteristics make it a potential dye or fluorescent probe, which can be used for biological imaging or molecular detection.
3. Photosensitive material: Due to its nitro and hydroxyl groups, it can be excited by light radiation, so it can be used for the preparation of photosensitive materials.

As for the preparation method, a common method is preparation by chloro substitution reaction of quinoline. 3-chloro-4-hydroxyquinoline can be synthesized first, then the chlorine atom can be replaced by bromine with a bromination reagent, and the nitro function can be introduced by the reaction of nitric acid and sulfuric acid.

Regarding safety information, the specific safety of this compound needs to be evaluated based on laboratory conditions and methods of use. However, in general, it is an organic nitrate compound that can cause irritation to the skin, eyes and respiratory system, so appropriate protective measures should be taken when handling, such as wearing protective gloves, goggles and breathing masks. In addition, it should be used under well-ventilated laboratory conditions, and avoid contact with flammable substances and dangerous factors such as high temperature and fire sources. In the process of use, should follow the relevant safety procedures. To ensure safety, it is best to operate in an experienced chemical laboratory or under the guidance of a professional.

Last Update：2024-04-09 22:09:11