6-Phenylpyridin-2(1H)-one
Phenylpyridone
CAS: 19006-82-7
Molecular Formula: C11H9NO
6-Phenylpyridin-2(1H)-one - Names and Identifiers
| Name | Phenylpyridone |
| Synonyms | Phenylpyridone Einecs 242-740-9 6-PHENYL-2-PYRIDONE 6-Phenylpyridin-2(1H) 6-Phenylpyridin-2(1H)-one 2-HYDROXY-6-PHENYLPYRIDINE |
| CAS | 19006-82-7 |
| EINECS | 242-740-9 |
| InChI | InChI=1/C11H9NO/c13-11-8-4-7-10(12-11)9-5-2-1-3-6-9/h1-8H,(H,12,13) |
6-Phenylpyridin-2(1H)-one - Physico-chemical Properties
| Molecular Formula | C11H9NO |
| Molar Mass | 171.2 |
| Density | 1.158g/cm3 |
| Melting Point | 197 °C |
| Boling Point | 417.1°C at 760 mmHg |
| Flash Point | 246.1°C |
| Vapor Presure | 3.64E-07mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Orange to Green |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.594 |
| MDL | MFCD00059760 |
6-Phenylpyridin-2(1H)-one - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
6-Phenylpyridin-2(1H)-one - Introduction
Phenylpyridone, chemical formula C12H9NO, is an organic compound. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: Phenylpyridone is a white crystalline solid.
2. Solubility: Soluble in ethanol, chloroform and dichloromethane, insoluble in water.
3. Melting Point: about 137-139 ℃.
4. Molecular weight: 183.21g/mol.
Use:
1. Phenylpyridone is widely used in the field of organic synthesis.
2. It can be used as a drug intermediate, such as the synthesis of anticancer drugs and antiviral drugs.
3. The compound can also be used as a dye and pigment synthesis.
Method:
Phenylpyridone is often prepared by one of the following methods:
1. By the amination reaction of benzophenone and pyridine.
2. By the condensation reaction of aniline and pyridine -2-ketone.
Safety Information:
1. Phenylpyridone may have irritating effects on the eyes, skin and respiratory tract, and contact with these parts should be avoided.
2. Please wear appropriate personal protective equipment, such as gloves, protective glasses and protective masks.
3. In the process of Operation should avoid inhalation of steam or dust, to ensure that the operation area is well ventilated.
4. Please store the compound in a sealed container, away from fire and high temperature.
5. If exposure or ingestion occurs, seek medical attention immediately and provide relevant information to the doctor.
Nature:
1. Appearance: Phenylpyridone is a white crystalline solid.
2. Solubility: Soluble in ethanol, chloroform and dichloromethane, insoluble in water.
3. Melting Point: about 137-139 ℃.
4. Molecular weight: 183.21g/mol.
Use:
1. Phenylpyridone is widely used in the field of organic synthesis.
2. It can be used as a drug intermediate, such as the synthesis of anticancer drugs and antiviral drugs.
3. The compound can also be used as a dye and pigment synthesis.
Method:
Phenylpyridone is often prepared by one of the following methods:
1. By the amination reaction of benzophenone and pyridine.
2. By the condensation reaction of aniline and pyridine -2-ketone.
Safety Information:
1. Phenylpyridone may have irritating effects on the eyes, skin and respiratory tract, and contact with these parts should be avoided.
2. Please wear appropriate personal protective equipment, such as gloves, protective glasses and protective masks.
3. In the process of Operation should avoid inhalation of steam or dust, to ensure that the operation area is well ventilated.
4. Please store the compound in a sealed container, away from fire and high temperature.
5. If exposure or ingestion occurs, seek medical attention immediately and provide relevant information to the doctor.
Last Update：2024-04-09 02:00:43
Supplier List
Product Name: 6-Phenyl-2-Pyridone Visit Supplier Webpage Request for quotation
CAS: 19006-82-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 19006-82-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 6-Phenyl-2-Pyridone Visit Supplier Webpage Request for quotation
CAS: 19006-82-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 19006-82-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History