6-amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione - Names and Identifiers
Name | 6-Amino-1,3-dipropyluracil
|
Synonyms | AKOS BBS-00006550 SALOR-INT L157864-1EA 1,3-DIPROPYL-6-AMINOURACIL 6-AMINO-1,3-DIPROPYLURACIL 6-Amino-1,3-dipropyluracil 6-amino-1,3-dipropylpyrimidine-2,4-dione 6-Amino-1,3-dipropyl-1H-pyrimidine-2,4-dione 6-AMINO-1,3-DIPROPYL-1H-PYRIMIDINE-2,4-DIONE 6-amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione 6-AMINO-1,3-DIPROPYL-2,4(1H,3H)-PYRIMIDINEDIONE
|
CAS | 41862-14-0
|
InChI | InChI=1/C10H17N3O2/c1-3-5-12-8(11)7-9(14)13(6-4-2)10(12)15/h7H,3-6,11H2,1-2H3 |
6-amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione - Physico-chemical Properties
Molecular Formula | C10H17N3O2
|
Molar Mass | 211.26 |
Density | 1.120±0.06 g/cm3(Predicted) |
Melting Point | 134-139 °C |
Boling Point | 308.3±45.0 °C(Predicted) |
Flash Point | 140.3°C |
Solubility | Dichloromethane, Ethyl Acetate, Methanol |
Vapor Presure | 0.000685mmHg at 25°C |
Appearance | Solid |
Color | White |
pKa | 5.17±0.70(Predicted) |
Storage Condition | -20°C Freezer |
Refractive Index | 1.515 |
6-amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | 22 - Harmful if swallowed
|
WGK Germany | 3 |
6-amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione - Introduction
6-Amino-1,3-dipropyluracil(6-Amino-1,3-dipropyluracil) is an organic compound with the following properties:
1. Appearance: colorless or yellowish crystal powder.
2. Solubility: Soluble in water and organic solvents such as chloroform and ethanol.
3. melting point: about 165-169 ℃.
4. molecular formula: C9H16N4O.
5. molecular weight: 196.25.
6-Amino-1,3-dipropyluracil can be used for the following purposes:
1. Medical field: As an antiviral drug, it is often used to treat viral infections, especially diseases caused by respiratory syncytial virus (RSV) infection.
2. cosmetics field: can be used as a sunscreen and skin protectant, with certain antioxidant and anti-inflammatory effects.
The method for preparing 6-Amino-1,3-dipropyluracil is as follows:
6-Amino-1,3-dipropyluracil can be synthesized by the condensation reaction of p-dipropylamino propionate and urea.
Note the following safety information when using 6-Amino-1,3-dipropyluracil:
1. Wear appropriate personal protective equipment, such as gloves and glasses.
2. avoid contact with skin and eyes, such as accidental contact should immediately rinse with plenty of water.
3. storage should be sealed, away from the fire and oxidant.
4. Follow the instructions for use and properly handle and dispose of waste. If you have any concerns or discomfort, you should seek medical attention immediately.
Last Update:2024-04-09 21:21:28