6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione

6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione - Names and Identifiers

Name	6-amino-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione
Synonyms	1-ISOBUTYL-6-AMINOURACIL 4-Amino-3-isobutylpyrimidine-2,6-dione 6-amino-1-isobutylpyrimidine-2,4(1H,3H)-dione 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione 6-amino-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione 2,4(1H,3H)-Pyrimidinedione, 6-amino-1-(2-methylpropyl)-
CAS	56075-75-3
InChI	InChI=1/C8H13N3O2/c1-5(2)4-11-6(9)3-7(12)10-8(11)13/h3,5H,4,9H2,1-2H3,(H,10,12,13)

6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione - Physico-chemical Properties

Molecular Formula	C8H13N3O2
Molar Mass	183.21
Density	1.171g/cm³
Melting Point	270-273°C
Solubility	DMSO (Slightly), Methanol (Slightly)
Appearance	Solid
Color	White to Off-White
Storage Condition	-20°C Freezer
Refractive Index	1.517

6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione - Introduction

6-amino-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione is an organic compound with the chemical formula C9H14N4O2, commonly abbreviated as IAC.

The properties of the compound are as follows:
Appearance: White crystal
Melting point: 172-174 degrees Celsius
Solubility: Soluble in acid and alkali, insoluble in water

The main uses of 6-amino-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione include:
1. In organic synthesis, it is used as a catalyst, ligand or intermediate for the synthesis of other compounds.
2. In drug research and development, it can be used to develop anti-cancer drugs, antiviral drugs, etc.
3. as a chemical reagent for laboratory analysis and research.

One method for preparing 6-amino-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione is through the reaction of 3-isobutyramidopropionitrile with ammonia.

For safety information, the following precautions need to be observed:
1. The compound is relatively stable, but should avoid contact with strong oxidants.
2. in the process of operation, should take appropriate protective measures, such as wearing protective gloves and glasses.
3. avoid inhalation, ingestion or contact with the skin to avoid dust.
4. If you touch your skin or eyes by accident, rinse immediately with plenty of water and seek medical help.

Last Update：2024-04-09 20:02:46