6-bromo-4,8-dichloro-quinoline-3-carbonitrile
6-bromo-4,8-dichloro-quinoline-3-carbonitrile
CAS: 886362-77-2
Molecular Formula: C10H3BrCl2N2
6-bromo-4,8-dichloro-quinoline-3-carbonitrile - Names and Identifiers
| Name | 6-bromo-4,8-dichloro-quinoline-3-carbonitrile |
| Synonyms | 6-Bromo-4,8-dichloro-quinoline-3 6-bromo-4,8-dichloroquinoline-3-carbonitrile 6-Bromo-4,8-dichloro-3-quinolinecarbonitrile 6-bromo-4,8-dichloro-quinoline-3-carbonitrile 3-Quinolinecarbonitrile, 6-bromo-4,8-dichloro- |
| CAS | 886362-77-2 |
| InChI | InChI=1/C10H3BrCl2N2/c11-6-1-7-9(13)5(3-14)4-15-10(7)8(12)2-6/h1-2,4H |
6-bromo-4,8-dichloro-quinoline-3-carbonitrile - Physico-chemical Properties
| Molecular Formula | C10H3BrCl2N2 |
| Molar Mass | 301.95 |
| Density | 1.85g/cm3 |
| Boling Point | 429°C at 760 mmHg |
| Flash Point | 213.3°C |
| Vapor Presure | 1.45E-07mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.718 |
6-bromo-4,8-dichloro-quinoline-3-carbonitrile - Introduction
6-bromo-4, is a chemical with the formula C11H3BrCl2N. The following is a description of its nature, use, preparation and safety information:
1. nature:
-Appearance: 6-bromo-4, is a white or yellowish solid.
-Solubility: It can be dissolved in most organic solvents.
-Melting point: Its melting point is about 125-131 degrees Celsius.
-Stability: The compound is relatively stable at room temperature.
2. use:
- 6-bromo-4, it has certain application value in the field of medicine and pesticide. It can be used as an intermediate for some compounds with antibacterial, antiviral, and anticancer activities.
-At the same time, it can also be used in organic synthesis and chemical research.
3. preparation method:
- 6-bromo-4, and can be prepared by a variety of synthetic methods. One of the common methods is to use 6-bromo-4, 8-dichloroquinoline and sodium cyanide in an appropriate solvent Reaction, and then through purification to obtain the target product.
4. Safety Information:
- 6-bromo-4, is less toxic and dangerous, but as a chemical substance, it still needs to be stored and used correctly.
-Wear appropriate personal protective equipment such as goggles, gloves and laboratory clothing when used.
-Avoid contact with skin, eyes and respiratory tract, and ensure operation in a well-ventilated area.
-If ingested or exposed to the substance, seek medical attention immediately and take the relevant safety technical information to the hospital.
1. nature:
-Appearance: 6-bromo-4, is a white or yellowish solid.
-Solubility: It can be dissolved in most organic solvents.
-Melting point: Its melting point is about 125-131 degrees Celsius.
-Stability: The compound is relatively stable at room temperature.
2. use:
- 6-bromo-4, it has certain application value in the field of medicine and pesticide. It can be used as an intermediate for some compounds with antibacterial, antiviral, and anticancer activities.
-At the same time, it can also be used in organic synthesis and chemical research.
3. preparation method:
- 6-bromo-4, and can be prepared by a variety of synthetic methods. One of the common methods is to use 6-bromo-4, 8-dichloroquinoline and sodium cyanide in an appropriate solvent Reaction, and then through purification to obtain the target product.
4. Safety Information:
- 6-bromo-4, is less toxic and dangerous, but as a chemical substance, it still needs to be stored and used correctly.
-Wear appropriate personal protective equipment such as goggles, gloves and laboratory clothing when used.
-Avoid contact with skin, eyes and respiratory tract, and ensure operation in a well-ventilated area.
-If ingested or exposed to the substance, seek medical attention immediately and take the relevant safety technical information to the hospital.
Last Update：2024-04-09 21:11:58
