6-chloro-4,5-dimethyl-3-Pyridinamine

6-chloro-4,5-dimethyl-3-Pyridinamine - Names and Identifiers

Name	6-Chloro-4,5-dimethyl-3-pyridinamine
Synonyms	6-Chloro-4,5-diMethylpyridin-3-aMine 6-chloro-4,5-dimethyl-3-Pyridinamine 6-Chloro-4,5-dimethyl-3-pyridinamine 5-aMino-2-chloro-3,4-diMethylpyridine 3-Pyridinamine, 6-chloro-4,5-dimethyl-
CAS	147440-83-3
InChI	InChI=1S/C7H9ClN2/c1-4-5(2)7(8)10-3-6(4)9/h3H,9H2,1-2H3

6-chloro-4,5-dimethyl-3-Pyridinamine - Physico-chemical Properties

Molecular Formula	C7H9ClN2
Molar Mass	156.61
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C

6-chloro-4,5-dimethyl-3-Pyridinamine - Introduction

6-choro-4, 5-dimethyl-3-pyridinamine, also known as ACDMPP (5-amino-2-choro-3, 4-dimethylpyridinine), has the following properties:

1. Appearance: white to almost white crystal
2. Molecular formula: C, H, ClN
3. Molecular weight: 153.62g/mol
4. Melting Point: 95-99 ℃
5. Boiling point: 312 ℃

ACDMPP has a wide range of uses in certain areas, including:

1. Chemical catalyst: ACDMPP can be used as a catalyst precursor for catalytic reactions in organic synthesis, such as Carbonylation and amidation reactions.
2. Drug intermediates: ACDMPP can be used for the synthesis of intermediates of certain drugs, such as herbal anhydride antiepileptic drugs.
3. Dye intermediates: ACDMPP can also be used to synthesize some dyes intermediates.

ACDMPP preparation method generally has two kinds:

1.6-Chloro-4,5-dimethyl-3-pyridinamine is obtained by chlorination of 3,4-lutidine and then by amination.
2. Another preparation method is to obtain 6-Chloro-4,5-dimethyl-3-pyridinamine by chlorination of 2-amino -3, 4-dimethylpyridine.

regarding the safety information of ACDMPP, the following precautions should be paid attention to when using and storing:

1. ACDMPP is irritating and corrosive, please wear appropriate personal protective equipment such as protective gloves, goggles and protective clothing.
2. Avoid inhalation, avoid contact with skin and eyes, if contact, should immediately rinse with plenty of water.
3. During storage, keep away from fire sources, prevent direct sunlight, and store in a sealed container.

When using and handling ACDMPP, please ensure correct operation and comply with relevant safety operating procedures and regulations.

Last Update：2024-04-09 21:21:28