6-methoxy-2-phenylchromen-4-one
6-Methoxyflavone
CAS: 26964-24-9
Molecular Formula: C16H12O3
6-methoxy-2-phenylchromen-4-one - Names and Identifiers
| Name | 6-Methoxyflavone |
| Synonyms | BRN 0218520 6-METHOXYFLAVONE 6-Methoxyflavone 6-methoxy-flavon METHOXYFLAVONE, 6- Flavone, 6-methoxy- (7CI,8CI) 6-methoxy-2-phenylchromen-4-one 6-methoxy-2-phenyl-chromen-4-one 6-Methoxy-2-phenyl-4-benzopyrone 6-methoxy-2-phenyl-4-benzopyrone 6-methoxy-2-phenyl-4H-chromen-4-one 6-methoxy-2-phenyl-4h-1-benzopyran-4-on 6-methoxy-2-phenyl-4h-1-benzopyran-4-one 6-Methoxy-2-phenyl-4H-1-benzopyran-4-one 4H-1-Benzopyran-4-one, 6-methoxy-2-phenyl- 5-18-02-00257 (Beilstein Handbook Reference) |
| CAS | 26964-24-9 |
| EINECS | 248-144-5 |
| InChI | InChI=1/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
6-methoxy-2-phenylchromen-4-one - Physico-chemical Properties
| Molecular Formula | C16H12O3 |
| Molar Mass | 252.26 |
| Density | 1.240±0.06 g/cm3(Predicted) |
| Melting Point | 163-165°C(lit.) |
| Boling Point | 421.2±45.0 °C(Predicted) |
| Flash Point | 200.3°C |
| Vapor Presure | 2.66E-07mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | `sensitive` to water |
| Refractive Index | 1.614 |
| MDL | MFCD00017322 |
6-methoxy-2-phenylchromen-4-one - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 2 |
| RTECS | DJ3100438 |
6-methoxy-2-phenylchromen-4-one - Introduction
6-Methoxyflavone(6-Methoxyflavone) is a flavonoid compound with the following properties:
1. Appearance: 6-Methoxyflavone is colorless crystal or white powder.
2. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide and chloroform, insoluble in water.
3. Melting Point: Melting point range is usually 118-120 ℃.
4. Molecular Structure: chemical formula is C16H12O3, molecular weight is 252.27.
5. Stability: 6-Methoxyflavone is stable at room temperature and relatively stable under dry conditions.
6-Methoxyflavone has multiple uses, including but not limited to the following:
1. Drug research: 6-Methoxyflavone has antioxidant, anti-inflammatory and anti-tumor activities, and is widely used in the field of drug research.
2. Food additives: 6-Methoxyflavone has the functions of protecting food quality and extending shelf life, so it can be used as a food additive.
3. Cosmetics industry: 6-Methoxyflavone is widely used in cosmetics industry because of its antioxidant and whitening effect.
The preparation method of 6-Methoxyflavone can generally be synthesized by the following steps:
1. First, mix the appropriate amount of flavonoids with methanol solvent.
2. Add acid catalyst (such as sulfuric acid or organic acid) and stir.
3. At an appropriate temperature, the reaction for a certain period of time, so that the reactant in methanol methoxylation reaction.
4. The reaction mixture was filtered and the product was obtained.
6-Methoxyflavone is safer under normal conditions of use, but the following safety information should be paid attention:
1. Avoid contact with skin and eyes, such as contact should immediately rinse with plenty of water.
2. Wear appropriate personal protective equipment such as lab gloves, glasses, and protective clothing during use or handling.
3. Avoid inhalation of its dust or vapor, should be operated in a well-ventilated environment.
4. In the use of the process, should follow the correct experimental procedures and safe operation guide.
Due to individual differences, please refer to relevant information or consult professional advice for specific safety issues and usage methods.
1. Appearance: 6-Methoxyflavone is colorless crystal or white powder.
2. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide and chloroform, insoluble in water.
3. Melting Point: Melting point range is usually 118-120 ℃.
4. Molecular Structure: chemical formula is C16H12O3, molecular weight is 252.27.
5. Stability: 6-Methoxyflavone is stable at room temperature and relatively stable under dry conditions.
6-Methoxyflavone has multiple uses, including but not limited to the following:
1. Drug research: 6-Methoxyflavone has antioxidant, anti-inflammatory and anti-tumor activities, and is widely used in the field of drug research.
2. Food additives: 6-Methoxyflavone has the functions of protecting food quality and extending shelf life, so it can be used as a food additive.
3. Cosmetics industry: 6-Methoxyflavone is widely used in cosmetics industry because of its antioxidant and whitening effect.
The preparation method of 6-Methoxyflavone can generally be synthesized by the following steps:
1. First, mix the appropriate amount of flavonoids with methanol solvent.
2. Add acid catalyst (such as sulfuric acid or organic acid) and stir.
3. At an appropriate temperature, the reaction for a certain period of time, so that the reactant in methanol methoxylation reaction.
4. The reaction mixture was filtered and the product was obtained.
6-Methoxyflavone is safer under normal conditions of use, but the following safety information should be paid attention:
1. Avoid contact with skin and eyes, such as contact should immediately rinse with plenty of water.
2. Wear appropriate personal protective equipment such as lab gloves, glasses, and protective clothing during use or handling.
3. Avoid inhalation of its dust or vapor, should be operated in a well-ventilated environment.
4. In the use of the process, should follow the correct experimental procedures and safe operation guide.
Due to individual differences, please refer to relevant information or consult professional advice for specific safety issues and usage methods.
Last Update：2024-04-09 21:01:54
Supplier List
Spot supply
Product Name: 6-Methoxyflavone Visit Supplier Webpage Request for quotationCAS: 26964-24-9
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Multiple SpecificationsSpot supply
Product Name: 6-Methoxyflavone Visit Supplier Webpage Request for quotationCAS: 26964-24-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 6-Methoxyflavone Visit Supplier Webpage Request for quotationCAS: 26964-24-9
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Multiple SpecificationsSpot supply
Product Name: 6-Methoxyflavone Visit Supplier Webpage Request for quotationCAS: 26964-24-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History