| Name | Chlorophenetole |
| Synonyms | Chlorophenetole 2-Chlorophenetole O-CHLOROPHENETOLE O-CHLOROETHOXYBENZENE 2-Phenoxyethyl chloride 2-chlorophenolethylether 1-CHLORO-2-ETHOXYBENZENE benzene,1-chloro-2-ethoxy- 2-Chlorophenol ethyl ether Benzene, 1-chloro-2-ethoxy- |
| CAS | 614-72-2 |
| EINECS | 210-392-7 |
| InChI | InChI=1/C8H9ClO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3 |
| Molecular Formula | C8H9ClO |
| Molar Mass | 156.61 |
| Density | 1,14 g/cm3 |
| Melting Point | 190-191.5 °C |
| Boling Point | 210 °C |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.51 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Raw Materials | 4-CHLOROPHENOL SODIUM SALT DIETHYL BENZYLPHOSPHONATE Ethanol 2-Chlorophenol 2-Chloroaniline o-Phenetidine Diethyl sulfate 1,2-Dichlorobenzene |
| Downstream Products | 2-Ethoxyphenol 4-CHLOROPHENETOLE |
| Specific gravity | 1.14 |