6272-45-3

6272-45-3 - Names and Identifiers

Name	(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid
Synonyms	RARECHEM BK HW 0174 4-BENZYLOXYCINNAMIC ACID 4-benzyloxycinnamic acid (E)-4-BENZYLOXYCINNAMIC ACID (E)-4-Benzyloxycinnamic acid 3-[4-(BENZYLOXY)PHENYL]ACRYLIC ACID 3-[4-(Benzyloxy)Phenyl]Acrylic Acid (E)-3-(4-(Benzyloxy)phenyl)acrylic acid (2E)-3-[4-(benzyloxy)phenyl]prop-2-enoate (E)-3-[4-(BENZYLOXY)PHENYL]-2-PROPENOIC ACID (2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid 3-[4-(Benzyloxy)phenyl]acrylic acid, 3-[4-(Benzyloxy)phenyl]prop-2-enoic acid
CAS	6272-45-3
InChI	InChI=1/C16H14O3/c17-16(18)11-8-13-6-9-15(10-7-13)19-12-14-4-2-1-3-5-14/h1-11H,12H2,(H,17,18)/p-1/b11-8+

6272-45-3 - Physico-chemical Properties

Molecular Formula	C16H14O3
Molar Mass	254.28
Density	1.212
Melting Point	206-208°C
Boling Point	448.9±25.0 °C(Predicted)
Flash Point	169.1°C
Vapor Presure	7.63E-09mmHg at 25°C
pKa	4.59±0.10(Predicted)
Storage Condition	Room Temprature

6272-45-3 - Risk and Safety

Hazard Class

IRRITANT

6272-45-3 - Introduction

(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic is an organic compound with the chemical formula C17H16O3. Its main properties are as follows:

1. Appearance:(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid is white crystalline powder.

2. solubility:(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid can be dissolved in some organic solvents, such as ethanol, dimethyl sulfoxide, etc.

3. Stability: The compound is stable under conventional experimental conditions.

4. uses:(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid is commonly used in organic synthesis reactions, such as for the synthesis of polymers containing acrylic acid groups, pharmaceutical materials, etc.

5. preparation method:(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid can be obtained by condensation reaction of 4-benzyloxybenzaldehyde with acrylic acid.

6. Safety information: Due to limited relevant research data, there is no specific toxicological and safety information on (2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid. Therefore, in the process of using or handling the compound, attention should be paid to taking appropriate safety measures, such as wearing personal protective equipment, avoiding contact with skin and eyes, and ensuring that the operating environment is well ventilated. At the same time, according to the operation requirements, refer to the relevant safety technical documents and chemical safety data.

Last Update：2024-04-09 21:11:58