69962-41-0
N,N-Diallyl-3-aminoacetanilide
CAS: 69962-41-0
Molecular Formula: C14H18N2O
69962-41-0 - Names and Identifiers
| Name | N,N-Diallyl-3-aminoacetanilide |
| Synonyms | 3-(Diallylamino)acetanilide N,N-Diallyl-3-aminoacetanilide N,N-DIALLYL-3-AMINOACETANILIDE 3-(N,N-Diallyl)aminoacetanilide 3-(N,N-DIALLYL)AMINO ACETANILIDE Acetamide, N-[3-(di-2-propen-1-ylamino)phenyl]- |
| CAS | 69962-41-0 |
| InChI | InChI=1/C14H18N2O/c1-4-9-16(10-5-2)14-8-6-7-13(11-14)15-12(3)17/h4-8,11H,1-2,9-10H2,3H3,(H,15,17) |
69962-41-0 - Physico-chemical Properties
| Molecular Formula | C14H18N2O |
| Molar Mass | 230.31 |
| Density | 1.062 |
| Refractive Index | 1.587 |
69962-41-0 - Introduction
N,N-Diallyl-3-aminoacetanilide is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: Colorless or light yellow crystalline solid.
2. solubility: soluble in some organic solvents, such as acetic acid and alcohol, slightly soluble in water.
3. melting point: about 70-75 degrees Celsius.
Use:
1. chemical reagents: can be used as reagents in organic synthesis, for the synthesis of other compounds.
2. Enzyme inhibitors: In biochemical research, it can be used as enzyme inhibitors to study the activity and mechanism of enzymes.
Preparation Method:
The preparation of N,N-Diallyl-3-aminoacetanilide can be carried out by the following steps:
1. reacting aniline with triethylamine to generate a triethylamine salt of aniline.
2. Under alkaline conditions, the triethylamine salt reacts with p-acrylate to generate p-propenyl benzylamine.
3. under the medium of alcohol, the reaction of p-propenyl benzylamine with formyl chloride generates N,N-Diallyl-3-aminoacetanilide.
Safety Information:
1. N,N-Diallyl-3-aminoacetanilide may be irritating to eyes, skin and respiratory tract. Avoid contact with these parts when using.
2. Wear appropriate protective equipment such as protective gloves and goggles during use.
3. Avoid inhaling its gas or dust, and maintain a well-ventilated working environment.
4. storage should avoid high temperature, fire and organic contact, to prevent possible danger.
5. If inhaled or exposed to this compound, seek medical attention immediately and take the product label or container to the hospital.
Nature:
1. Appearance: Colorless or light yellow crystalline solid.
2. solubility: soluble in some organic solvents, such as acetic acid and alcohol, slightly soluble in water.
3. melting point: about 70-75 degrees Celsius.
Use:
1. chemical reagents: can be used as reagents in organic synthesis, for the synthesis of other compounds.
2. Enzyme inhibitors: In biochemical research, it can be used as enzyme inhibitors to study the activity and mechanism of enzymes.
Preparation Method:
The preparation of N,N-Diallyl-3-aminoacetanilide can be carried out by the following steps:
1. reacting aniline with triethylamine to generate a triethylamine salt of aniline.
2. Under alkaline conditions, the triethylamine salt reacts with p-acrylate to generate p-propenyl benzylamine.
3. under the medium of alcohol, the reaction of p-propenyl benzylamine with formyl chloride generates N,N-Diallyl-3-aminoacetanilide.
Safety Information:
1. N,N-Diallyl-3-aminoacetanilide may be irritating to eyes, skin and respiratory tract. Avoid contact with these parts when using.
2. Wear appropriate protective equipment such as protective gloves and goggles during use.
3. Avoid inhaling its gas or dust, and maintain a well-ventilated working environment.
4. storage should avoid high temperature, fire and organic contact, to prevent possible danger.
5. If inhaled or exposed to this compound, seek medical attention immediately and take the product label or container to the hospital.
Last Update：2024-04-09 02:00:47
