705927-37-3
7-Bromo-1H-indazol-6-ol
CAS: 705927-37-3
Molecular Formula: C7H5BrN2O
705927-37-3 - Names and Identifiers
| Name | 7-Bromo-1H-indazol-6-ol |
| Synonyms | 7-Bromo-1H-indazol-6-ol 1H-Indazol-6-ol, 7-broMo- 1H-Indazol-6-ol, 7-bromo- |
| CAS | 705927-37-3 |
| InChI | InChI=1S/C7H5BrN2O/c8-6-5(11)2-1-4-3-9-10-7(4)6/h1-3,11H,(H,9,10) |
705927-37-3 - Physico-chemical Properties
| Molecular Formula | C7H5BrN2O |
| Molar Mass | 213.03 |
705927-37-3 - Introduction
7-Bromo-1H-indazol-6-ol (7-Bromo-1H-indazol-6-ol) is an organic compound with the chemical formula C7H5BrN2O. Its properties are as follows:
1. Appearance: colorless to light yellow solid.
2. Solubility: Soluble in most organic solvents.
7-Bromo-1H-indazol-6-ol is widely used in chemical research and drug synthesis:
1. Intermediate: As an intermediate for the synthesis of other organic compounds, it can be used to synthesize various organic compounds, such as drugs, dyes and materials.
2. Drug research: Due to its unique structure, 7-Bromo-1H-indazol-6-ol is widely used in the research of anti-cancer drugs and has potential anti-tumor activity.
The method of preparing 7-Bromo-1H-indazol-6-ol usually includes the following steps:
1. Using indole as the starting material, it is converted into 7-bromoindole through a series of chemical reactions.
2. react 7-bromoindole with an appropriate amount of alkali (such as sodium carbonate) under mild conditions to generate 7-Bromo-1H-indazol-6-ol.
Regarding safety information, since 7-Bromo-1H-indazol-6-ol is an organic bromide, the following matters need to be noted:
1. toxicity: has a certain toxicity, should avoid direct contact with skin, eyes and respiratory tract.
2. combustion: with flammability, should avoid contact with open flame or high temperature.
3. storage and handling: should be stored in a dry, cool place, and avoid contact with oxidants and flammable materials.
When using 7-Bromo-1H-indazol-6-ol, follow the relevant safety procedures and take appropriate protective measures, such as wearing protective gloves, glasses and masks. Always follow the safety guidelines of your laboratory or institution.
1. Appearance: colorless to light yellow solid.
2. Solubility: Soluble in most organic solvents.
7-Bromo-1H-indazol-6-ol is widely used in chemical research and drug synthesis:
1. Intermediate: As an intermediate for the synthesis of other organic compounds, it can be used to synthesize various organic compounds, such as drugs, dyes and materials.
2. Drug research: Due to its unique structure, 7-Bromo-1H-indazol-6-ol is widely used in the research of anti-cancer drugs and has potential anti-tumor activity.
The method of preparing 7-Bromo-1H-indazol-6-ol usually includes the following steps:
1. Using indole as the starting material, it is converted into 7-bromoindole through a series of chemical reactions.
2. react 7-bromoindole with an appropriate amount of alkali (such as sodium carbonate) under mild conditions to generate 7-Bromo-1H-indazol-6-ol.
Regarding safety information, since 7-Bromo-1H-indazol-6-ol is an organic bromide, the following matters need to be noted:
1. toxicity: has a certain toxicity, should avoid direct contact with skin, eyes and respiratory tract.
2. combustion: with flammability, should avoid contact with open flame or high temperature.
3. storage and handling: should be stored in a dry, cool place, and avoid contact with oxidants and flammable materials.
When using 7-Bromo-1H-indazol-6-ol, follow the relevant safety procedures and take appropriate protective measures, such as wearing protective gloves, glasses and masks. Always follow the safety guidelines of your laboratory or institution.
Last Update：2024-04-09 21:21:28
Supplier List
Product Name: 1H-Indazol-6-ol, 7-broMo- Visit Supplier Webpage Request for quotation
CAS: 705927-37-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 705927-37-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 1H-Indazol-6-ol, 7-broMo- Visit Supplier Webpage Request for quotation
CAS: 705927-37-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 705927-37-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History