7275-43-6
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate
CAS: 7275-43-6
Molecular Formula: C10H8N2O2
7275-43-6 - Names and Identifiers
| Name | 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate |
| Synonyms | AKOS BBS-00002966 2,2'-dipyridyldioxide 2,2'-Dipyridyl dioxide 2,2'-Bipyridin-1,1'-dioxid 2,2'-Bipyridyl-1,1'-dioxide 2,2'-DIPYRIDYL N,N'-DIOXIDE 2,2'-Dipyridyl N,N'-dioxide 2,2'-Bipyridine 1,1'-dioxide 2,2'-Bipyridine-1,1'-dioxyde 2,2'-BIPYRIDINE 1,1'-DIOXIDE 2,2'-bipyridine, 1,1'-dioxide [2,2']Bipyridinyl 1,1'-dioxide 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate 1-oxo-6-(1-oxopiperidinium-2-yl)-1,2-dihydropyridinium 2,2'-Dipyridyl N,N'-dioxide2,2'-Bipyridine-1,1'-dioxide (2Z)-2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate |
| CAS | 7275-43-6 |
| EINECS | 625-380-0 |
| InChI | InChI=1/C10H8N2O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
7275-43-6 - Physico-chemical Properties
| Molecular Formula | C10H8N2O2 |
| Molar Mass | 188.18 |
| Density | 1.2577 (rough estimate) |
| Melting Point | 296-298°C(lit.) |
| Boling Point | 323.18°C (rough estimate) |
| Water Solubility | Soluble in water |
| Appearance | Powder |
| Color | Off-white to cream |
| pKa | -1.34±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5910 (estimate) |
7275-43-6 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | DW1770000 |
| HS Code | 29333999 |
7275-43-6 - Introduction
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is an organic compound with the chemical formula C12H6N2O3. Its molecular structure contains a 1,2-dioxide group and a bipyridine ring structure, forming a completely new molecule.
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate has the following properties:
1. Appearance: A pale yellow to yellow solid.
2. melting point: about 280-285 degrees Celsius.
3. Solubility: It has good solubility in water.
4. Chemical properties: It is an unstable compound and is easy to decompose.
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is widely used and is mainly used in the following aspects:
1. Catalyst: It can be used as a catalyst to play a role in organic synthesis and promote the progress of chemical reactions.
2. raw materials: can be used as raw materials for organic synthesis, further synthesis of other compounds.
3. Fluorescent dye: Due to its special molecular structure, it can sometimes be used as a fluorescent dye.
the preparation method of 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is relatively complicated, which can usually be synthesized by multi-step reaction and requires certain organic synthesis technology.
Regarding safety information, since 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is a chemical substance, the following should be noted when using it:
1. Avoid contact with skin and eyes. If there is contact, rinse immediately with plenty of water.
2. during the operation should wear appropriate personal protective equipment, such as gloves, glasses, etc.
3. should be operated in a well-ventilated place to avoid inhalation of its vapor.
4. Keep the container tightly closed during storage, away from fire and oxidant.
Because 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate may have other specific safety precautions, please carefully study the relevant chemical information before use and follow the safe operating procedures.
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate has the following properties:
1. Appearance: A pale yellow to yellow solid.
2. melting point: about 280-285 degrees Celsius.
3. Solubility: It has good solubility in water.
4. Chemical properties: It is an unstable compound and is easy to decompose.
2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is widely used and is mainly used in the following aspects:
1. Catalyst: It can be used as a catalyst to play a role in organic synthesis and promote the progress of chemical reactions.
2. raw materials: can be used as raw materials for organic synthesis, further synthesis of other compounds.
3. Fluorescent dye: Due to its special molecular structure, it can sometimes be used as a fluorescent dye.
the preparation method of 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is relatively complicated, which can usually be synthesized by multi-step reaction and requires certain organic synthesis technology.
Regarding safety information, since 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate is a chemical substance, the following should be noted when using it:
1. Avoid contact with skin and eyes. If there is contact, rinse immediately with plenty of water.
2. during the operation should wear appropriate personal protective equipment, such as gloves, glasses, etc.
3. should be operated in a well-ventilated place to avoid inhalation of its vapor.
4. Keep the container tightly closed during storage, away from fire and oxidant.
Because 2-(1-oxopyridinium-2(1H)-ylidene)pyridin-1(2H)-olate may have other specific safety precautions, please carefully study the relevant chemical information before use and follow the safe operating procedures.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: 2,2'-Bipyridyl 1,1'-Dioxide Visit Supplier Webpage Request for quotationCAS: 7275-43-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 2,2-Dipyridyl N,N-Dioxide Visit Supplier Webpage Request for quotation
CAS: 7275-43-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 7275-43-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2,2 '- bipyridine-n, n' - nitrogen oxide Request for quotation
CAS: 7275-43-6
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 7275-43-6
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
Spot supply
Product Name: 2,2'-Bipyridyl 1,1'-Dioxide Visit Supplier Webpage Request for quotationCAS: 7275-43-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 2,2-Dipyridyl N,N-Dioxide Visit Supplier Webpage Request for quotation
CAS: 7275-43-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 7275-43-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2,2 '- bipyridine-n, n' - nitrogen oxide Request for quotation
CAS: 7275-43-6
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 7275-43-6
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
View History