76393-18-5
2,6-dibromo-4-(fluorophenyl)isocyanate
CAS: 76393-18-5
Molecular Formula: C7H2Br2FNO
76393-18-5 - Names and Identifiers
| Name | 2,6-dibromo-4-(fluorophenyl)isocyanate |
| Synonyms | 2,6-DIBROMO-4-FLUOROPHENYL ISOCYANATE 2,6-dibromo-4-(fluorophenyl)isocyanate 1,3-dibromo-5-fluoro-2-isocyanatobenzene |
| CAS | 76393-18-5 |
| InChI | InChI=1/C7H2Br2FNO/c8-5-1-4(10)2-6(9)7(5)11-3-12/h1-2H |
76393-18-5 - Physico-chemical Properties
| Molecular Formula | C7H2Br2FNO |
| Molar Mass | 294.9 |
| Density | 2.01g/cm3 |
| Melting Point | 43-47°C(lit.) |
| Boling Point | 295.5°C at 760 mmHg |
| Flash Point | >230°F |
| Vapor Presure | 0.00152mmHg at 25°C |
| BRN | 8617287 |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.614 |
76393-18-5 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | III |
76393-18-5 - Introduction
2,6-dibromo-4-(fluorophenyl)isocyanate is an organic compound with a molecular formula of C8H3Br2FNO and a molecular weight of 278.92g/mol. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: 2,6-dibromo-4-(fluorophenyl)isocyanate is a colorless to light yellow crystal or crystalline powder.
-Melting point: The melting point of the compound is about 89-92°C.
-Stability: 2,6-dibromo-4-(fluorophenyl)isocyanate is relatively stable at room temperature, but it may produce dangerous reactions under the action of high temperature, fire source or strong oxidant.
Use:
- 2,6-dibromo-4-(fluorophenyl)isocyanate can be used as a reagent in organic synthesis and is often used in the synthesis of other organic compounds.
-It is often used as an intermediate in the preparation of drugs and pesticides, such as for the synthesis of organic compounds such as fempinib (Fenopin).
Preparation Method:
2,6-dibromo-4-(fluorophenyl)isocyanate is usually prepared by the following steps:
1. First, 2,6-dibromo-4-fluorophenylcarboxylic acid is reacted with hydrocyanic acid to obtain the corresponding acid chloride.
2. The resulting acid chloride is then reacted with an isocyanate to produce 2,6-dibromo-4-(fluorophenyl)isocyanate.
Safety Information:
- 2,6-dibromo-4-(fluorophenyl)isocyanate is an organic compound. Pay attention to safe operation during handling, such as wearing appropriate protective gloves and goggles.
-Avoid inhaling the dust of this compound. If you accidentally come into contact with skin or eyes, rinse immediately with plenty of water and seek medical advice as soon as possible.
-During storage, the compound should be kept in a dry, cool place, away from fire and oxidizing agents.
Nature:
-Appearance: 2,6-dibromo-4-(fluorophenyl)isocyanate is a colorless to light yellow crystal or crystalline powder.
-Melting point: The melting point of the compound is about 89-92°C.
-Stability: 2,6-dibromo-4-(fluorophenyl)isocyanate is relatively stable at room temperature, but it may produce dangerous reactions under the action of high temperature, fire source or strong oxidant.
Use:
- 2,6-dibromo-4-(fluorophenyl)isocyanate can be used as a reagent in organic synthesis and is often used in the synthesis of other organic compounds.
-It is often used as an intermediate in the preparation of drugs and pesticides, such as for the synthesis of organic compounds such as fempinib (Fenopin).
Preparation Method:
2,6-dibromo-4-(fluorophenyl)isocyanate is usually prepared by the following steps:
1. First, 2,6-dibromo-4-fluorophenylcarboxylic acid is reacted with hydrocyanic acid to obtain the corresponding acid chloride.
2. The resulting acid chloride is then reacted with an isocyanate to produce 2,6-dibromo-4-(fluorophenyl)isocyanate.
Safety Information:
- 2,6-dibromo-4-(fluorophenyl)isocyanate is an organic compound. Pay attention to safe operation during handling, such as wearing appropriate protective gloves and goggles.
-Avoid inhaling the dust of this compound. If you accidentally come into contact with skin or eyes, rinse immediately with plenty of water and seek medical advice as soon as possible.
-During storage, the compound should be kept in a dry, cool place, away from fire and oxidizing agents.
Last Update：2024-04-09 21:01:54
