770-69-4
1-ethyltricyclo[3.3.1.1~3,7~]decane
CAS: 770-69-4
Molecular Formula: C12H20
770-69-4 - Names and Identifiers
| Name | 1-ethyltricyclo[3.3.1.1~3,7~]decane |
| Synonyms | 1-ETHYLADAMANTANE 1-Ethyladamantane adamantane,1-ethyl- 1-ethyltricyclo[3.3.1.13,7]decane 1-ethyltricyclo[3.3.1.1~3,7~]decane tricyclo[3.3.1.13,7]decane,1-ethyl- tricyclo[3.3.1.1~3,7~]decane, 1-ethyl- |
| CAS | 770-69-4 |
| InChI | InChI=1/C12H20/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,2-8H2,1H3 |
770-69-4 - Physico-chemical Properties
| Molecular Formula | C12H20 |
| Molar Mass | 164.29 |
| Density | 0.94 |
| Melting Point | -57.7℃ |
| Boling Point | 229 °C |
| Flash Point | 69.7±11.7℃ |
| Solubility | Chloroform (Sparingly), Methanol (Slightly), Ethyl Acetate (Slightly) |
| Vapor Presure | 0.232mmHg at 25°C |
| Appearance | Oil |
| Specific Gravity | 0.94 |
| Color | Colourless |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4950 (589.3 nm 20℃ |
| MDL | MFCD00142626 |
770-69-4 - Risk and Safety
| Hazard Class | IRRITANT |
770-69-4 - Introduction
1-ethyltricyclo[3.3.1.1~3,7 ~]decane(1-ethyltricyclo[3.3.1.1~3,7 ~]decane) is an organic compound with the following properties:
1. Appearance: colorless liquid
2. Molecular formula: C13H24
3. Molecular weight: 180.33g/mol
4. melting point:-50 ℃
5. Boiling point: 207-208 ℃
6. Density: 0.813g/cm3
1-ethyltricyclo[3.3.1.1~3,7 ~]decane is mainly used as follows:
1. Solvent: Due to its low toxicity and low volatility, it can be used as a solvent in organic synthesis reactions, especially in low-temperature reactions.
2. chemical intermediate: 1-ethyltricyclo[3.3.1.1~3,7 ~]decane can be used as an intermediate in some organic synthesis reactions for the synthesis of other organic compounds.
Preparation Method:
1-ethyltricyclo[3.3.1.1~3,7 ~]decane can be prepared by the following reaction:
First, 1-cyclopropylcyclopentadiene is reacted with pentadiene at a low temperature to obtain 1-cyclopropylpentadiene.
Then, 1-cyclopropylpentadiene is reacted with ethyl ethanesulfonate under acid catalysis to produce 1-ethyltricyclo[3.3.1.1~3,7 ~]decane.
Safety Information:
1-ethyltricyclo[3.3.1.1~3,7 ~]decane is less harmful to human body and environment under normal conditions. But as an organic solvent, it still has a certain degree of volatility and flammability. Care should be taken to avoid contact with skin, inhalation or swallowing during use. At the same time, it should be operated in a well-ventilated environment, away from open flames and high temperatures. If taken by mistake or inhaled by mistake, seek medical attention immediately.
1. Appearance: colorless liquid
2. Molecular formula: C13H24
3. Molecular weight: 180.33g/mol
4. melting point:-50 ℃
5. Boiling point: 207-208 ℃
6. Density: 0.813g/cm3
1-ethyltricyclo[3.3.1.1~3,7 ~]decane is mainly used as follows:
1. Solvent: Due to its low toxicity and low volatility, it can be used as a solvent in organic synthesis reactions, especially in low-temperature reactions.
2. chemical intermediate: 1-ethyltricyclo[3.3.1.1~3,7 ~]decane can be used as an intermediate in some organic synthesis reactions for the synthesis of other organic compounds.
Preparation Method:
1-ethyltricyclo[3.3.1.1~3,7 ~]decane can be prepared by the following reaction:
First, 1-cyclopropylcyclopentadiene is reacted with pentadiene at a low temperature to obtain 1-cyclopropylpentadiene.
Then, 1-cyclopropylpentadiene is reacted with ethyl ethanesulfonate under acid catalysis to produce 1-ethyltricyclo[3.3.1.1~3,7 ~]decane.
Safety Information:
1-ethyltricyclo[3.3.1.1~3,7 ~]decane is less harmful to human body and environment under normal conditions. But as an organic solvent, it still has a certain degree of volatility and flammability. Care should be taken to avoid contact with skin, inhalation or swallowing during use. At the same time, it should be operated in a well-ventilated environment, away from open flames and high temperatures. If taken by mistake or inhaled by mistake, seek medical attention immediately.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 1-Ethyladamantane Visit Supplier Webpage Request for quotation
CAS: 770-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 770-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 1-Ethyladamantane Visit Supplier Webpage Request for quotation
CAS: 770-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 770-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History