79979-69-4
2-Amino-1-naphthoic acid
CAS: 79979-69-4
Molecular Formula: C11H9NO2
79979-69-4 - Names and Identifiers
| Name | 2-Amino-1-naphthoic acid |
| Synonyms | 2-Amino-1-naphthoic acid 2-Aminonaphthalene-1-carboxylic acid 2-Amino-1-naphthalenecarboxylic acid 1-Naphthalenecarboxylic acid, 2-amino- 1-Naphthalenecarboxylic acid, 2-aMino- |
| CAS | 79979-69-4 |
| InChI | InChI=1S/C11H9NO2/c12-9-6-5-7-3-1-2-4-8(7)10(9)11(13)14/h1-6H,12H2,(H,13,14) |
79979-69-4 - Physico-chemical Properties
| Molecular Formula | C11H9NO2 |
| Molar Mass | 187.19 |
| Density | 1.352±0.06 g/cm3(Predicted) |
| Melting Point | 126 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
| Boling Point | 420.7±28.0 °C(Predicted) |
| pKa | 5.10±0.10(Predicted) |
| Storage Condition | Room Temprature |
79979-69-4 - Introduction
2-Amino-1-napthoic acid, chemical formula C11H9NO2, is also known in the field of chemistry as 2-amino-naphthalene-1-acid or 2-aminonaphthoic acid.
Its properties are as follows:
1. Appearance: White to light yellow crystalline powder.
2. melting point: 200-206 degrees celsius.
3. Solubility: Slightly soluble in water, soluble in acid and alkali solution.
4. stability: stable at room temperature and pressure conditions.
2-Amino-1-napthoic acid has several common uses:
1. Organic synthesis intermediate: As an organic acid, it can be used as an intermediate for the synthesis of dyes, drugs and other organic compounds.
2. dyes: can be used to prepare a variety of organic dyes, including fluorescent dyes and natural dyes.
3. Optical applications: Due to its specific optical properties, it can be used to prepare optical materials, such as optical coatings and optical brighteners.
The methods for preparing 2-Amino-1-napthoic acid mainly include the following:
1. The condensation reaction of naphthalene and chloroacetic acid in synthetic esters.
2. by chloroacetate and 2-naphthalenone ketone condensation reaction.
3. The oxidation reaction of naphthalene and chloroacetic acid.
Regarding the safety information of 2-Amino-1-napthoic acid, the following points should be noted:
1. The compound is irritating when in contact with skin, eyes or inhalation, and direct contact or inhalation of dust should be avoided.
2. Use the process should wear appropriate protective clothing, protective glasses and respiratory protection equipment.
3. should be stored away from the fire and oxidant.
4. Please properly handle or dispose of waste items and comply with local environmental regulations.
Its properties are as follows:
1. Appearance: White to light yellow crystalline powder.
2. melting point: 200-206 degrees celsius.
3. Solubility: Slightly soluble in water, soluble in acid and alkali solution.
4. stability: stable at room temperature and pressure conditions.
2-Amino-1-napthoic acid has several common uses:
1. Organic synthesis intermediate: As an organic acid, it can be used as an intermediate for the synthesis of dyes, drugs and other organic compounds.
2. dyes: can be used to prepare a variety of organic dyes, including fluorescent dyes and natural dyes.
3. Optical applications: Due to its specific optical properties, it can be used to prepare optical materials, such as optical coatings and optical brighteners.
The methods for preparing 2-Amino-1-napthoic acid mainly include the following:
1. The condensation reaction of naphthalene and chloroacetic acid in synthetic esters.
2. by chloroacetate and 2-naphthalenone ketone condensation reaction.
3. The oxidation reaction of naphthalene and chloroacetic acid.
Regarding the safety information of 2-Amino-1-napthoic acid, the following points should be noted:
1. The compound is irritating when in contact with skin, eyes or inhalation, and direct contact or inhalation of dust should be avoided.
2. Use the process should wear appropriate protective clothing, protective glasses and respiratory protection equipment.
3. should be stored away from the fire and oxidant.
4. Please properly handle or dispose of waste items and comply with local environmental regulations.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: 2-Amino-1-naphthoic acid Visit Supplier Webpage Request for quotation
CAS: 79979-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 79979-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Amino-1-naphthoic acid Visit Supplier Webpage Request for quotation
CAS: 79979-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 79979-69-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History