8-bromo-1,6-naphthyridin-5(6H)-one
8-bromo-1,6-naphthyridin-5(6H)-one
CAS: 155057-97-9
Molecular Formula: C8H5BrN2O
8-bromo-1,6-naphthyridin-5(6H)-one - Names and Identifiers
| Name | 8-bromo-1,6-naphthyridin-5(6H)-one |
| Synonyms | 8-Bromo-1,6-naphthyridin-5(6H) 8-bromo-6h-1,6-naphthyridin-5-one 8-bromo-1,6-naphthyridin-5(6H)-one 8-Bromo-1,6-naphthyridin-5(6H)-one c8-Bromo-1,6-naphthyridin-5(6H)-one 1,6-Naphthyridin-5(6H)-one, 8-bromo- 8-bromo-5,6-dihydro-1,6-naphthyridin-5-one |
| CAS | 155057-97-9 |
| InChI | InChI=1/C8H5BrN2O/c9-6-4-11-8(12)5-2-1-3-10-7(5)6/h1-4H,(H,11,12) |
8-bromo-1,6-naphthyridin-5(6H)-one - Physico-chemical Properties
| Molecular Formula | C8H5BrN2O |
| Molar Mass | 225.04 |
| Density | 1.762±0.06 g/cm3(Predicted) |
| Melting Point | 247-251 °C(Solv: water (7732-18-5)) |
| Boling Point | 451.1±45.0 °C(Predicted) |
| Flash Point | 226.64°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 9.47±0.40(Predicted) |
| Storage Condition | Room Temprature |
| Sensitive | Irritant |
| Refractive Index | 1.665 |
| MDL | MFCD00928592 |
8-bromo-1,6-naphthyridin-5(6H)-one - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
8-bromo-1,6-naphthyridin-5(6H)-one - Introduction
8-bromo-1, 6-naphythyridin-5 (6h)-one is an organic compound with the molecular formula C13H8BrNO, which is a powdery solid substance.
The properties of this compound are:
1. Appearance: 8-bromo-1, 6-naphythyridin-5 (6h)-one is white or light yellow crystal powder.
2. Melting Point: has a high melting point, about 206-210 ℃.
3. Solubility: It has good solubility in some organic solvents (such as chloroform, acetone and dimethyl sulfoxide).
It has many applications in the laboratory and industry:
1. Chemical reagents: can be used as reagents in organic synthesis reactions, such as applications in the synthesis of drugs and pesticides.
2. Photosensitive material: due to the special nature of its molecular structure, it can be used for the preparation of photosensitive materials.
3. Organic synthesis intermediates: can be used as intermediates for the synthesis of other compounds.
Regarding the preparation method, 8-bromo-1,6-naphthyridin-5(6h)-one can be prepared by the following steps:
1. First, 1,6-naphthoketone is reacted with hydrogen bromide. The reaction conditions may be carried out by heating in the presence of acetic acid.
2. The reaction product is 8-bromo -1,6-naphthoketone, further processing:
a. 8-bromo -1,6-naphthoketone is reacted with pyridine under acid catalysis.
B. Reaction conditions are Reflux reaction, usually in acetic acid.
c. The product obtained by the reaction is 8-bromo-1,6-naphthyridin-5(6h)-one.
Regarding safety information, 8-bromo-1,6-naphthyridin-5(6h)-one is an organic compound, so appropriate safety measures need to be taken:
1. Avoid contact with skin and eyes, such as contact, should immediately rinse with plenty of water.
2. Use should be carried out in a well-ventilated place to avoid inhaling its dust.
3. Should be stored away from the fire and oxidant.
4. Follow proper laboratory procedures and personal protective measures.
The properties of this compound are:
1. Appearance: 8-bromo-1, 6-naphythyridin-5 (6h)-one is white or light yellow crystal powder.
2. Melting Point: has a high melting point, about 206-210 ℃.
3. Solubility: It has good solubility in some organic solvents (such as chloroform, acetone and dimethyl sulfoxide).
It has many applications in the laboratory and industry:
1. Chemical reagents: can be used as reagents in organic synthesis reactions, such as applications in the synthesis of drugs and pesticides.
2. Photosensitive material: due to the special nature of its molecular structure, it can be used for the preparation of photosensitive materials.
3. Organic synthesis intermediates: can be used as intermediates for the synthesis of other compounds.
Regarding the preparation method, 8-bromo-1,6-naphthyridin-5(6h)-one can be prepared by the following steps:
1. First, 1,6-naphthoketone is reacted with hydrogen bromide. The reaction conditions may be carried out by heating in the presence of acetic acid.
2. The reaction product is 8-bromo -1,6-naphthoketone, further processing:
a. 8-bromo -1,6-naphthoketone is reacted with pyridine under acid catalysis.
B. Reaction conditions are Reflux reaction, usually in acetic acid.
c. The product obtained by the reaction is 8-bromo-1,6-naphthyridin-5(6h)-one.
Regarding safety information, 8-bromo-1,6-naphthyridin-5(6h)-one is an organic compound, so appropriate safety measures need to be taken:
1. Avoid contact with skin and eyes, such as contact, should immediately rinse with plenty of water.
2. Use should be carried out in a well-ventilated place to avoid inhaling its dust.
3. Should be stored away from the fire and oxidant.
4. Follow proper laboratory procedures and personal protective measures.
Last Update：2024-04-09 21:54:55
