8-chloro-2,3-dihydrochroMen-4-one - Names and Identifiers
Name | 8-chloro-2,3-dihydro-4H-chromen-4-one
|
Synonyms | LogP 8-Chloro-4-chromanone 8-CHLOROCHROMAN-4-ONE 8-chloro-2,3-dihydrochroMen-4-one 8-Chloro-2,3-dihydro-4H-chromen-4-one 8-chloro-2,3-dihydro-4H-chromen-4-one 8-CHLORO-2,3-DIHYDRO-4H-CHROMEN-4-ONE 8-CHLORO-3,4-DIHYDRO-2H-1-BENZOPYRAN-4- 8-Chloro-2,3-dihydro-4H-1-benzopyran-4-one 8-CHLORO-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-ONE 4H-1-benzopyran-4-one, 8-chloro-2,3-dihydro- 5-((1-(2-Chlorobenzyl)-1H-indol-3-yl)methylene)-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione
|
CAS | 49701-11-3
|
EINECS | 1312995-182-4 |
InChI | InChI=1/C9H7ClO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2 |
8-chloro-2,3-dihydrochroMen-4-one - Physico-chemical Properties
Molecular Formula | C9H7ClO2
|
Molar Mass | 182.6 |
Density | 1.345±0.06 g/cm3(Predicted) |
Melting Point | 65℃ |
Boling Point | 321.8±42.0 °C(Predicted) |
Flash Point | 149.6°C |
Vapor Presure | 0.000291mmHg at 25°C |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.578 |
8-chloro-2,3-dihydrochroMen-4-one - Introduction
8-choro-2, 3-dihydro-4H-chromen-4-one is an organic compound with the chemical formula C9H6Cl2O2. Its nature is as follows:
Appearance: Colorless crystal or white crystalline powder.
Solubility: Slightly soluble or insoluble in common solvents.
Melting point: about 120°C.
Boiling point: approximately 285°C.
density: about 1.4g/cm³.
The main uses of 8-choro-2, 3-dihydro-4H-chromen-4-one include:
1. Pesticide preparation: It can be used as a pesticide intermediate to participate in the manufacture of certain pesticides and fungicides.
2. Drug synthesis: The compound can be used to synthesize some biologically active drugs, such as anti-tumor drugs, anti-inflammatory drugs, etc.
The preparation methods of 8-choro-2, 3-dihydro-4H-chromen-4-one mainly include the following:
1. Through the reaction of phenol and p-chlorobenzoyl chloride, p-chlorobenzoic acid ester is generated, and then the target product is obtained by acid hydrolysis.
2. The chlorination reaction can be carried out by introducing chlorine atoms on the chromone molecule, such as using cuprous chloride or ferric chloride.
Safety information about 8-choro-2, 3-dihydro-4H-chromen-4-one:
1. ingestion or inhalation of the substance may be harmful to human body, should avoid contact.
2. appropriate protective measures should be taken during operation, such as wearing gloves, goggles and protective clothing.
3. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical help.
4. to be stored in a dry and ventilated place, away from the fire and flammable substances.
Last Update:2024-04-09 21:54:55