Name | Cucurbituril |
Synonyms | CUCURBITURIL Cucurbituril cucurbit[6]uril Curcubit[6]uril Cucurbituril[6] Cucurbituril [6] Cucurbit[6]uril hydrate Cucurbit[6]uril hydrate contains acid of crystalization |
CAS | 80262-44-8 |
InChI | InChI=1/C36H36N24O12/c61-25-37-1-38-14-16-42(26(38)62)4-46-18-20-50(30(46)66)8-54-22-24-58(34(54)70)11-57-23-21-53(33(57)69)7-49-19-17-45(29(49)65)3-41(25)15-13(37)39-2-40(14)28(64)44(16)6-48(18)32(68)52(20)10-56(22)36(72)60(24)12-59(23)35(71)55(21)9-51(19)31(67)47(17)5-43(15)27(39)63/h13-24H,1-12H2/t13-,14+,15+,16-,17-,18+,19+,20-,21-,22+,23+,24- |
InChIKey | MSBXTPRURXJCPF-UHFFFAOYSA-N |
Molecular Formula | C36H36N24O12 |
Molar Mass | 996.82 |
Density | 2.66±0.1 g/cm3(Predicted) |
Melting Point | ~470°C |
Solubility | Pure water is almost insoluble, soluble in inorganic salt water (concentration about 0.1M) solution or strong acid, such as hydrochloric acid and sulfuric acid above 20%, the process is relatively slow, increasing the amount of acid or heating at 50 ℃ will dissolve faster. If it forms molecules with other organic matter, it cannot be dissolved after assembly. |
Appearance | Colorless or white powder |
Color | white |
BRN | 4933186 |
pKa | 0.02±0.20(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 2.341 |
Use | This product is for scientific research only and shall not be used for other purposes. |
WGK Germany | 3 |
Overview | cucuronium (CB[n]) is a class of instrumental molecules with potential applications in molecular recognition. |
Use | in recent years, nucleic acid supramolecular studies through the developed functional guest molecules of CB[n] as well as the principle of response to external stimuli have found practical application. |