83881-47-4
Methyl 2-(2-chloroethoxy)acetate
CAS: 83881-47-4
Molecular Formula: C5H9ClO3
83881-47-4 - Names and Identifiers
| Name | Methyl 2-(2-chloroethoxy)acetate |
| Synonyms | methyl 2-(2-chloroet methyl (2-chloroethoxy)acetate Methyl 2-(2-chloroethoxy)acetate 2-(2-Chloroethoxy)acetic acid methyl ester (2-CHLORO-ETHOXY)-ACETIC ACID METHYL ESTER Acetic acid,2-(2-chloroethoxy)-, Methyl ester |
| CAS | 83881-47-4 |
| EINECS | 200-258-5 |
| InChI | InChI=1/C5H9ClO3/c1-8-5(7)4-9-3-2-6/h2-4H2,1H3 |
83881-47-4 - Physico-chemical Properties
| Molecular Formula | C5H9ClO3 |
| Molar Mass | 152.58 |
| Density | 1.2081 g/cm3 |
| Boling Point | 98-99 °C(Press: 19 Torr) |
| Flash Point | 90.1°C |
| Vapor Presure | 0.199mmHg at 25°C |
| Refractive Index | 1.421 |
83881-47-4 - Reference Information
| use | 2-(2-chloroethoxy) methyl acetate is a useful research chemical for organic synthesis and other chemical processes. |
Last Update：2024-04-09 15:16:37
