867333-43-5

867333-43-5 - Names and Identifiers

Name	(5-Cyano-2-methylphenyl)boronic acid
Synonyms	5-Cyano-2-methylphenylboronic acid (5-Cyano-2-methylphenyl)boronic acid Boronicacid,B-(5-cyano-2-methylphenyl)- Boronic acid, (5-cyano-2-methylphenyl)-
CAS	867333-43-5
InChI	InChI=1S/C8H8BNO2/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-4,11-12H,1H3

867333-43-5 - Physico-chemical Properties

Molecular Formula	C8H8BNO2
Molar Mass	160.97
Density	1.20±0.1 g/cm3(Predicted)
Boling Point	373.4±52.0 °C(Predicted)
pKa	7.25±0.58(Predicted)
Storage Condition	Inert atmosphere,Room Temperature

867333-43-5 - Introduction

(5-Cyano-2-methylphenyl)boronic acid is an organic compound with the chemical formula C9H9BNO2. Its properties are as follows:

1. Appearance: white or almost white crystalline powder;
2. solubility: soluble in ethanol, dimethylformamide and formamide, slightly soluble in water;
3. melting point: about 195-198 degrees Celsius;
4. Stability: Stable under typical laboratory conditions.

(5-Cyano-2-methylphenyl)boronic acid is widely used and is often used as an intermediate and reagent in organic synthesis. Some important applications include:

1. Catalyst: It can be used as a ligand of palladium or platinum to participate in catalytic cross-coupling reactions, such as Suzuki coupling reaction and Negishi coupling reaction;
2. Fluorescent dye: It can be used for the synthesis of dyes, especially the preparation of compounds with fluorescent properties;
3. Drug research: It can be used as a building block of drug molecules for drug research and drug synthesis.

(5-Cyano-2-methylphenyl)boronic acid is generally synthesized by reacting phenylboronic acid with a cyano compound. The specific reaction conditions can be adjusted according to the specific situation.

Regarding safety information,(5-Cyano-2-methylphenyl)boronic acid is a general organic compound and is generally non-toxic to the human body. But as an organic compound, still need to pay attention to the following matters:

1. avoid inhalation of dust or contact with skin;
2. in the process of operation should wear protective glasses and gloves;
3. avoid contact with strong oxidants.

For further safety requirements, please refer to the chemical's safety data sheets and related materials.

Last Update：2024-04-09 20:02:46