884494-45-5
2-FLUORO-4-IODO-6-PICOLINE
CAS: 884494-45-5
Molecular Formula: C6H5FIN
884494-45-5 - Names and Identifiers
| Name | 2-FLUORO-4-IODO-6-PICOLINE |
| Synonyms | 2-FLUORO-4-IODO-6-PICOLINE 2-FLUORO-6-METHYL-4-IODOPYRIDINE 2-Fluoro-4-iodo-6-methylpyridine 2-fluoro-4-iodo-6-methyl-pyridine pyridine, 2-fluoro-4-iodo-6-methyl- Pyridine, 2-fluoro-4-iodo-6-Methyl- |
| CAS | 884494-45-5 |
| InChI | InChI=1/C6H5FIN/c1-4-2-5(8)3-6(7)9-4/h2-3H,1H3 |
| InChIKey | LJTFIDJMXXZXPN-UHFFFAOYSA-N |
884494-45-5 - Physico-chemical Properties
| Molecular Formula | C6H5FIN |
| Molar Mass | 237.01 |
| Density | 1.893g/cm3 |
| Boling Point | 230.273°C at 760 mmHg |
| Flash Point | 93.066°C |
| Vapor Presure | 0.101mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.587 |
884494-45-5 - Introduction
It is an organic compound whose chemical formula is C7H6FIN. The following is a detailed description of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: It is a colorless to light yellow solid.
-Solubility: Soluble in organic solvents such as ethanol, dimethylformamide and chlorinated carbon, insoluble in water.
-Melting point: about 114-116 ℃.
Use:
It is often used as a starting material, solvent and reagent in organic synthesis and has the following uses:
-as a hardening agent for light hardening coatings and printing inks.
-As an intermediate in organic synthesis, used in the synthesis of organic molecules and drugs.
Preparation Method:
The preparation of the table can be achieved through the following steps:
1. 4-Bromo-2-iodo-6-methylpyridine is reacted with hydrogen fluoride in an appropriate solvent.
2. After appropriate reaction conditions and purification steps, the final product is obtained.
Safety Information:
-It has a low toxicity rating and is generally considered to be less toxic.
-Avoid contact with strong oxidants and strong acids during operation and storage to prevent fire or explosion hazards.
-Wear appropriate personal protective equipment such as gloves, goggles, etc.
-in the use of the process should pay attention to ventilation, avoid inhalation of steam or dust.
-For accidental contact, wash the affected area. If it enters the eyes or skin, rinse immediately with plenty of water and seek medical help.
Nature:
-Appearance: It is a colorless to light yellow solid.
-Solubility: Soluble in organic solvents such as ethanol, dimethylformamide and chlorinated carbon, insoluble in water.
-Melting point: about 114-116 ℃.
Use:
It is often used as a starting material, solvent and reagent in organic synthesis and has the following uses:
-as a hardening agent for light hardening coatings and printing inks.
-As an intermediate in organic synthesis, used in the synthesis of organic molecules and drugs.
Preparation Method:
The preparation of the table can be achieved through the following steps:
1. 4-Bromo-2-iodo-6-methylpyridine is reacted with hydrogen fluoride in an appropriate solvent.
2. After appropriate reaction conditions and purification steps, the final product is obtained.
Safety Information:
-It has a low toxicity rating and is generally considered to be less toxic.
-Avoid contact with strong oxidants and strong acids during operation and storage to prevent fire or explosion hazards.
-Wear appropriate personal protective equipment such as gloves, goggles, etc.
-in the use of the process should pay attention to ventilation, avoid inhalation of steam or dust.
-For accidental contact, wash the affected area. If it enters the eyes or skin, rinse immediately with plenty of water and seek medical help.
Last Update：2024-04-09 15:18:00
Supplier List
Product Name: 2-FLUORO-4-IODO-6-PICOLINE Visit Supplier Webpage Request for quotation
CAS: 884494-45-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 884494-45-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-FLUORO-4-IODO-6-PICOLINE Visit Supplier Webpage Request for quotation
CAS: 884494-45-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 884494-45-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History