884494-97-7
6-Fluoro-2-methylnicotinic acid
CAS: 884494-97-7
Molecular Formula: C7H6FNO2
884494-97-7 - Names and Identifiers
| Name | 6-Fluoro-2-methylnicotinic acid |
| Synonyms | 6-Fluoro-2-methylnicotinic acid 6-FLUORO-2-METHYLNICOTINIC ACID 2-Methyl-6-Fluoro-3-Nicotinicacid 6-fluoro-2-Methylpyridine-3-carboxylic acid 6-Fluoro-2-methyl-3-pyridinecarboxylic acid 6-fluoro-2-methyl-pyridine-3-carboxylic acid 3-Pyridinecarboxylic acid, 6-fluoro-2-methyl- |
| CAS | 884494-97-7 |
| InChI | InChI=1/C7H6FNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3H,1H3,(H,10,11) |
884494-97-7 - Physico-chemical Properties
| Molecular Formula | C7H6FNO2 |
| Molar Mass | 155.13 |
| Density | 1.341 |
| Boling Point | 296.7°C at 760 mmHg |
| Flash Point | 133.2°C |
| Vapor Presure | 0.000637mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.536 |
884494-97-7 - Introduction
6-Fluoro-2-methylnicotinic acid, also known as 6-Fluoro-2-methylnicotinic acid, is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: 6-Fluoro-2-methylnicotinic acid is a white to light yellow crystalline solid.
-Melting point: about 142-146°C.
-Solubility: Soluble in a variety of organic solvents, such as alcohol, ether, ketone, etc.
Use:
-Drug research: 6-Fluoro-2-methylnicotinic acid is widely used in the field of drug research as an intermediate for the synthesis of new drugs.
-Pesticide research: It can also be used for the synthesis of pesticides.
-Organic synthesis: The compound can be used in organic synthesis reactions, such as the synthesis of catalysts.
Preparation Method:
- 6-Fluoro-2-methylnicotinic acid can be synthesized by various reaction pathways. A common method is to react 2-methylnicotinic acid with hydrogen fluoride or potassium fluoride and carry out the substitution reaction at a higher temperature.
-Other preparation methods include catalytic fluorination reaction, fluorine-based reaction, etc.
Safety Information:
- 6-Fluoro-2-methylnicotinic acid has relatively limited toxicity information and no toxicity data have been reported.
-Due to its chemical nature, appropriate personal protective equipment such as laboratory gloves, goggles, etc. should be worn when exposed to the compound.
-Avoid breathing gas, dust and powder, and ensure that the operation is carried out in a well-ventilated place.
-In case of skin contact or ingestion, rinse immediately with plenty of water and seek medical help.
-When storing and handling the compound, follow the relevant safety procedures.
Nature:
-Appearance: 6-Fluoro-2-methylnicotinic acid is a white to light yellow crystalline solid.
-Melting point: about 142-146°C.
-Solubility: Soluble in a variety of organic solvents, such as alcohol, ether, ketone, etc.
Use:
-Drug research: 6-Fluoro-2-methylnicotinic acid is widely used in the field of drug research as an intermediate for the synthesis of new drugs.
-Pesticide research: It can also be used for the synthesis of pesticides.
-Organic synthesis: The compound can be used in organic synthesis reactions, such as the synthesis of catalysts.
Preparation Method:
- 6-Fluoro-2-methylnicotinic acid can be synthesized by various reaction pathways. A common method is to react 2-methylnicotinic acid with hydrogen fluoride or potassium fluoride and carry out the substitution reaction at a higher temperature.
-Other preparation methods include catalytic fluorination reaction, fluorine-based reaction, etc.
Safety Information:
- 6-Fluoro-2-methylnicotinic acid has relatively limited toxicity information and no toxicity data have been reported.
-Due to its chemical nature, appropriate personal protective equipment such as laboratory gloves, goggles, etc. should be worn when exposed to the compound.
-Avoid breathing gas, dust and powder, and ensure that the operation is carried out in a well-ventilated place.
-In case of skin contact or ingestion, rinse immediately with plenty of water and seek medical help.
-When storing and handling the compound, follow the relevant safety procedures.
Last Update：2024-04-09 21:04:16
