893611-23-9
N-(2-Methoxybenzyl)butan-1-amine
CAS: 893611-23-9
Molecular Formula: C12H19NO
893611-23-9 - Names and Identifiers
| Name | N-(2-Methoxybenzyl)butan-1-amine |
| Synonyms | CHEMBRDG-BB 4022338 UKRORGSYN-BB BBV-123119 N-(2-methoxybenzyl)-1-butanamine N-(2-METHOXYBENZYL)BUTAN-1-AMINE N-(2-Methoxybenzyl)butan-1-amine N-(2-METHOXYPHENYLMETHYL)BUTYLAMINE Benzenemethanamine, N-butyl-2-methoxy- |
| CAS | 893611-23-9 |
| InChI | InChI=1/C12H19NO/c1-3-4-9-13-10-11-7-5-6-8-12(11)14-2/h5-8,13H,3-4,9-10H2,1-2H3 |
893611-23-9 - Physico-chemical Properties
| Molecular Formula | C12H19NO |
| Molar Mass | 193.29 |
| Density | 0.944g/cm3 |
| Boling Point | 267.6°C at 760 mmHg |
| Flash Point | 111.3°C |
| Vapor Presure | 0.00806mmHg at 25°C |
| Refractive Index | 1.498 |
893611-23-9 - Introduction
N-(2-Methoxybenzyl)butan-1-amine (N-(2-Methoxybenzyl)butan-1-amine) is an organic compound with the following properties:
1. Appearance: colorless or light yellow oily liquid.
2. solubility: soluble in common organic solvents, such as ethanol, acetone and dimethylformamide.
3. Melting point and boiling point: No specific values are provided.
4. molecular formula: C13H21NO, molar mass of 203.31g/mol.
The N-(2-Methoxybenzyl)butan-1-amine has several applications in the chemical and pharmaceutical fields:
1. Antibacterial agent: This compound can be used as an intermediate for some antibacterial drugs or chemicals.
2. Chemical reaction reagent: It can be used as a reagent and auxiliary agent in organic synthesis for the synthesis of target compounds.
3. pharmaceutical field: in some drug research, the compound can be used as raw material or catalyst.
The following steps are commonly used to make N-(2-Methoxybenzyl)butan-1-amine:
First, under suitable reaction conditions, 2-methoxybenzyl bromide is reacted with butylamine to generate the target product.
When using and handling N-(2-Methoxybenzyl)butan-1-amine, you need to pay attention to the following safety information:
1. Use should wear protective gloves, protective glasses and protective masks to avoid contact with skin, eyes and respiratory tract.
2. Avoid inhaling gases, fumes, vapors and dust.
3. Store in a closed container, away from fire and oxidant.
4. avoid contact with flammable substances and strong oxidants.
5. Waste disposal shall be in accordance with local regulations.
1. Appearance: colorless or light yellow oily liquid.
2. solubility: soluble in common organic solvents, such as ethanol, acetone and dimethylformamide.
3. Melting point and boiling point: No specific values are provided.
4. molecular formula: C13H21NO, molar mass of 203.31g/mol.
The N-(2-Methoxybenzyl)butan-1-amine has several applications in the chemical and pharmaceutical fields:
1. Antibacterial agent: This compound can be used as an intermediate for some antibacterial drugs or chemicals.
2. Chemical reaction reagent: It can be used as a reagent and auxiliary agent in organic synthesis for the synthesis of target compounds.
3. pharmaceutical field: in some drug research, the compound can be used as raw material or catalyst.
The following steps are commonly used to make N-(2-Methoxybenzyl)butan-1-amine:
First, under suitable reaction conditions, 2-methoxybenzyl bromide is reacted with butylamine to generate the target product.
When using and handling N-(2-Methoxybenzyl)butan-1-amine, you need to pay attention to the following safety information:
1. Use should wear protective gloves, protective glasses and protective masks to avoid contact with skin, eyes and respiratory tract.
2. Avoid inhaling gases, fumes, vapors and dust.
3. Store in a closed container, away from fire and oxidant.
4. avoid contact with flammable substances and strong oxidants.
5. Waste disposal shall be in accordance with local regulations.
Last Update：2024-04-09 21:21:28
