927209-98-1 - Names and Identifiers
Name | 4,4-difluorocyclohexanecarboxamide
|
Synonyms | 4,4-Difluorocyclohexanecarboxamide 4,4-difluorocyclohexanecarboxamide Cyclohexanecarboxamide, 4,4-difluoro- 4,4-Difluorocyclohexane-1-carboxamide 4,4-difluorocyclohexane carboxylic acid amide
|
CAS | 927209-98-1
|
InChI | InChI=1/C7H11F2NO/c8-7(9)3-1-5(2-4-7)6(10)11/h5H,1-4H2,(H2,10,11) |
927209-98-1 - Physico-chemical Properties
Molecular Formula | C7H11F2NO
|
Molar Mass | 163.17 |
Density | 1.18 |
Boling Point | 283℃ |
Flash Point | 125℃ |
Vapor Presure | 0.00326mmHg at 25°C |
pKa | 16.41±0.40(Predicted) |
Storage Condition | 2-8℃ |
Refractive Index | 1.439 |
927209-98-1 - Introduction
4, is an organic compound with the chemical formula C7H11F2NO. Its main properties are as follows:
1. Appearance: 4, it is a colorless or light yellow solid.
2. Solubility: It is soluble in ketones and alcohols, slightly soluble in water.
3. melting point: its melting point is about 50-54 degrees Celsius.
4, has a wide range of applications:
1. Pesticide: It can be used as one of the raw materials of pesticides and herbicides for crop protection and protective spraying.
2. Drug synthesis: It can be used as an intermediate for the synthesis of new drugs, such as the synthesis of anti-cancer drugs based on it.
3. Chemical research: It can be used as a reagent in organic synthesis chemical reactions, a catalyst or reagent involved in organic synthesis reactions.
Preparation 4, METHOD:
A common method is obtained by the reaction of cyclohexane and difluoroformamide. The specific reaction conditions need to be adjusted according to laboratory conditions and desired purity.
About safety information:
1. toxicity: 4. it has certain toxicity to human body and environment. contact with skin, eyes and inhalation of its vapor should be avoided.
2. fire extinguishing method: in case of fire, dry powder fire extinguisher, carbon dioxide fire extinguisher or foam fire extinguisher can be used to extinguish the fire.
3. storage and handling: should be stored in a cool, well-ventilated place, away from fire and oxidant. Wear appropriate personal protective equipment when handling or handling.
4. Waste disposal: According to local regulations, dispose of the discarded 4, r correctly to avoid pollution to the environment.
Please note that in order to ensure safety, the specific use, storage and handling methods should follow the relevant chemical safety procedures. When using the compound, refer to the appropriate safety data sheet and the relevant safety instructions.
Last Update:2024-04-09 20:00:08