943843-30-9

943843-30-9 - Names and Identifiers

Name	(S)-3-Amino-1-ethyl-2-azepanone hydrochloride
Synonyms	(S)-3-AMINO-1-ETHYL-AZEPAN-2-ONE HCL 3S-Amino-1-ethyl-azepan-2-one hydrochloride (S)-3-Amino-1-ethyl-2-azepanone hydrochloride (S)-3-amino-1-ethylazepan-2-one hydrochloride (3S)-3-Amino-1-ethylhexahydro-2H-azepin-2-one hydrochloride
CAS	943843-30-9
InChI	InChI=1S/C8H16N2O.ClH/c1-2-10-6-4-3-5-7(9)8(10)11;/h7H,2-6,9H2,1H3;1H/t7-;/m0./s1

943843-30-9 - Physico-chemical Properties

Molecular Formula	C8H17ClN2O
Molar Mass	192.69

943843-30-9 - Introduction

(S)-3-Amino-1-ethyl-2-azepanone hydrochloride ((S)-3-Amino-1-ethyl-2-azepanone hydrochloride) is a pharmaceutical intermediate with the following properties:

1. Appearance: White crystalline solid.
2. Molecular formula: C10H20N2O · HCl
3. Molecular weight: 230.8g/mol
4. Solubility: Soluble in water and polar organic solvents, such as alcohols and esters.
5. Melting point: about 118-120°C.

(S)-3-Amino-1-ethyl-2-azepanone hydrochloride can be used for the synthesis of posterior pituitary hormone release inhibitors, sedatives and other drugs. It can be used as an important intermediate of chiral synthesis in organic synthesis.

The preparation method of the compound is generally obtained by chemical synthesis, mainly by organic chemical reaction.

When using and handling this compound, you need to pay attention to the following safety information:

1. This is an organic compound. Follow laboratory practices and wear appropriate personal protective equipment, such as laboratory gloves, protective glasses and laboratory coats.
2. avoid inhalation of powder or solution, avoid contact with skin and eyes. In case of contact, rinse immediately with plenty of water.
3. during storage and handling, avoid contact with oxidants, strong acids or strong bases to avoid dangerous reactions.
4. to properly store the compound, in a dry, cool place, away from fire and flammable materials.
5. For the specific use and disposal of the compound, please follow the local laws and regulations.

Please note that the information on this compound is only brief and not comprehensive. Use and handling require thorough laboratory evaluation and follow relevant safety practices. If you need more detailed information, please consult the relevant professional body.

Last Update：2024-04-09 21:21:28