946681-75-0

946681-75-0 - Names and Identifiers

Name	3-(3-Bromophenoxy)pyrrolidine
Synonyms	3-(3-Bromophenoxy)pyrrolidine 3-(3-BROMOPHENOXY)PYRROLIDINE 3-(3-Bromophenoxy)-pyrrolidine 3-(3-Bromo-phenoxy)-pyrrolidine 3-(3-BroMophenoxy)-pyrrolidine HCl
CAS	946681-75-0
InChI	InChI=1S/C10H12BrNO/c11-8-2-1-3-9(6-8)13-10-4-5-12-7-10/h1-3,6,10,12H,4-5,7H2

946681-75-0 - Physico-chemical Properties

Molecular Formula	C10H12BrNO
Molar Mass	242.11238

946681-75-0 - Introduction

3-(3-Bromophenoxy)pyrrolidine is an organic compound commonly referred to chemically as 3-BPP. The following is a description of the nature, use, preparation and safety information of 3-BPP:

Nature:
-Appearance: 3-BPP is white crystalline powder.
-Solubility: 3-BPP is soluble in many organic solvents, such as ethanol, dimethyl sulfoxide and formamide.
-Stability: 3-BPP is stable at room temperature, but may decompose under high temperature or light conditions.

Use:
-Chemical synthesis: 3-BPP can be used as a starting material or intermediate in organic synthesis for the synthesis of other organic compounds.
-Drug research: 3-BPP has potential applications in drug research, such as as potential drug molecular targets or inhibitors.
-Materials Science: 3-BPP can be used to prepare functional materials, such as complexes, polymers, photovoltaic materials, etc.

Preparation Method:
A commonly used method for preparing 3-BPP is as follows:
-First, under the protection of nitrogen, 3-bromophenol and pyrrolidine are reacted to generate 3-(3-Bromophenoxy)pyrrolidine.
-The reaction is generally carried out in an organic solvent, such as dimethylsulfoxide or dimethylformamide.
-The reaction conditions can be adjusted according to the specific situation. Common reaction conditions include room temperature reaction, heating reaction or pressure reaction.

Safety Information:
3-BPP is generally relatively safe under normal use conditions, but the following matters should be paid attention to when using and handling:
-Avoid direct contact with skin, eyes and respiratory tract and use appropriate personal protective equipment such as gloves, goggles and protective masks.
-Avoid ingestion or inhalation and maintain good ventilation.
-Follow standard laboratory practices during use and handling, and follow relevant safety information and operating instructions.

In any case, it is recommended to conduct a detailed safety assessment before using 3-BPP, and follow relevant regulations and safety operation procedures.

Last Update：2024-04-09 21:01:54