998-41-4
tributylsilane
CAS: 998-41-4
Molecular Formula: C12H28Si
998-41-4 - Names and Identifiers
| Name | tributylsilane |
| Synonyms | Tributylsilan tributylsilane TRIBUTYLSILANE Silane, tributyl- tri-n-butylsilane |
| CAS | 998-41-4 |
| InChI | InChI=1/C12H27Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
998-41-4 - Physico-chemical Properties
| Molecular Formula | C12H28Si |
| Molar Mass | 200.44 |
| Density | 0.779g/mLat 25°C(lit.) |
| Boling Point | 225-226°C755mm Hg(lit.) |
| Flash Point | 182°F |
| Appearance | clear liquid |
| Specific Gravity | 0.7994 |
| Color | Colorless to Almost colorless |
| Storage Condition | 2-8℃ |
| Sensitive | 3: reacts with aqueous base |
| Refractive Index | n20/D 1.436(lit.) |
| MDL | MFCD00009415 |
998-41-4 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29319000 |
998-41-4 - Introduction
tributylsilane is an organosilicon compound with the chemical formula (C4H9)3SiH. The following is a description of the nature, use, preparation and safety information of the tributylsilane:
Nature:
1. Appearance: colorless liquid
2. Boiling point: about 170 ℃
3. density: about 0.781 g/cm
4. solubility: soluble in organic solvents such as alkanes and aromatic hydrocarbons, insoluble in water.
Use:
1. As a reducing agent: tributylsilane can be used as a reducing agent in organic synthesis reactions to reduce functional groups such as ketones and aldehydes in compounds to corresponding alcohols. As a solvent: tributylsilane can be used as a solvent for certain organic synthesis reactions, especially in cases where water or oxygen cannot be used, such as metal-catalyzed reactions.
3. Other uses: tributylsilane are also used in the electronic chemistry and semiconductor industries.
Preparation Method:
tributylsilane can be prepared by Grignard reagent method. Specifically, trichlorosilane (SiHCl3) and butyllithium (C4H9Li) react to produce tributylsilane and lithium chloride (LiCl).
Safety Information:
1. tributylsilane may be irritating to eyes and skin and should be avoided.
2. Inhalation or ingestion of tributylsilane may cause dizziness, nausea and other uncomfortable symptoms, should maintain a well-ventilated working environment.
3. tributylsilane should be stored in a closed container, away from fire and oxidant.
4. When handling tributylsilane, take appropriate personal protective measures, such as wearing gloves and protective glasses.
Please note that the above information is for reference only, specific experimental operations or industrial applications should follow the relevant safety practices and regulations.
Nature:
1. Appearance: colorless liquid
2. Boiling point: about 170 ℃
3. density: about 0.781 g/cm
4. solubility: soluble in organic solvents such as alkanes and aromatic hydrocarbons, insoluble in water.
Use:
1. As a reducing agent: tributylsilane can be used as a reducing agent in organic synthesis reactions to reduce functional groups such as ketones and aldehydes in compounds to corresponding alcohols. As a solvent: tributylsilane can be used as a solvent for certain organic synthesis reactions, especially in cases where water or oxygen cannot be used, such as metal-catalyzed reactions.
3. Other uses: tributylsilane are also used in the electronic chemistry and semiconductor industries.
Preparation Method:
tributylsilane can be prepared by Grignard reagent method. Specifically, trichlorosilane (SiHCl3) and butyllithium (C4H9Li) react to produce tributylsilane and lithium chloride (LiCl).
Safety Information:
1. tributylsilane may be irritating to eyes and skin and should be avoided.
2. Inhalation or ingestion of tributylsilane may cause dizziness, nausea and other uncomfortable symptoms, should maintain a well-ventilated working environment.
3. tributylsilane should be stored in a closed container, away from fire and oxidant.
4. When handling tributylsilane, take appropriate personal protective measures, such as wearing gloves and protective glasses.
Please note that the above information is for reference only, specific experimental operations or industrial applications should follow the relevant safety practices and regulations.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Tributylsilane Visit Supplier Webpage Request for quotation
CAS: 998-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 998-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Tributylsilane Visit Supplier Webpage Request for quotation
CAS: 998-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 998-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History