99974-66-0

99974-66-0 - Names and Identifiers

Name	diethyl 3-hydroxycyclobutane-1,1-dicarboxylate
Synonyms	LogP Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate DIETHYL 3-HYDROXYCYCLOBUTANE-1,1-DICARBOXYLATE diethyl 3-hydroxycyclobutane-1,1-dicarboxylate 1,1-cyclobutanedicarboxylic acid, 3-hydroxy-, diethyl ester 1,1-Cyclobutanedicarboxylic acid, 3-hydroxy-, 1,1-diethyl ester
CAS	99974-66-0
InChI	InChI=1/C10H16O5/c1-3-14-8(12)10(5-7(11)6-10)9(13)15-4-2/h7,11H,3-6H2,1-2H3

99974-66-0 - Physico-chemical Properties

Molecular Formula	C10H16O5
Molar Mass	216.23
Density	1.1108 g/cm3(Temp: 25 °C)
Boling Point	120-122 °C(Press: 3 Torr)
Flash Point	97.585°C
Vapor Presure	0.001mmHg at 25°C
pKa	14.23±0.40(Predicted)
Storage Condition	2-8°C
Refractive Index	1.497

99974-66-0 - Introduction

diethyl 3-hydroxycyclotane-1, 1-dicarboxylate(diethyl 3-hydroxycyclotane-1, 1-dicarboxylate) is an organic compound. Its structure contains a cyclobutane skeleton, in which one carbon atom is attached to a hydroxyl group and two carboxyl groups, and two ethyl ester groups are attached to the other two carbon atoms.

diethyl 3-hydroxycyclotane-1, 1-dicarboxylate mainly has the following properties:
1. appearance: usually colorless to yellowish liquid.
2. melting point and boiling point: melting point is about 15°C, boiling point is about 180°C.
3. Solubility: It is soluble in many organic solvents, such as alcohols and ethers.
4. Stability: relatively stable under conventional conditions.

diethyl 3-hydroxycyclotane-1, 1-dicarboxylate has certain uses in the chemical industry. It is often used as an intermediate in organic synthesis for the synthesis and preparation of other organic compounds, such as pharmaceuticals and chemicals. The cyclobutane and carboxylic acid functional groups can be introduced into the target compound by reaction with other reactants.

The method of preparing diethyl 3-hydroxycyclotane-1, 1-dicarboxylate can be carried out by the following steps:
1. A compound containing cyclobutane and carboxylic acid groups is reacted with ethanol to form a partially esterified product.
2. The hydrogen in the reaction solution is introduced into the reaction system to promote their condensation reaction with acid catalysis as the driving force to generate the final product.

When using and handling the diethyl 3-hydroxycyclotane-1, 1-dicarboxylate, you need to pay attention to the following safety precautions:
1. protective measures: in the operation should wear appropriate protective glasses, gloves and laboratory laminar flow hood and other personal protective equipment.
2. Storage and handling: It should be stored in a sealed container, kept away from fire and oxidant, and properly managed to avoid leakage.
3. Toxicity: The compound may be harmful to the human body under normal use conditions, and excessive exposure and swallowing should be avoided.
4. Waste disposal: Waste should be properly disposed of according to local environmental regulations, preferably through special channels.

Last Update：2024-04-09 21:32:44