AMDU
3'-amino-2',3'-dideoxyuridine
CAS: 84472-86-6
Molecular Formula: C9H13N3O4
AMDU - Names and Identifiers
| Name | 3'-amino-2',3'-dideoxyuridine |
| Synonyms | AMDU 3'-NH2-ddU 3'-amino-2',3'-dideoxyuridine 5-(azidomethyl)-2′-deoxyuridine (AmdU) 5-(azidomethyl)-1-((2R,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| CAS | 84472-86-6 |
| InChI | InChI=1/C9H13N3O4/c10-5-3-8(16-6(5)4-13)12-2-1-7(14)11-9(12)15/h1-2,5-6,8,13H,3-4,10H2,(H,11,14,15)/t5-,6+,8+/m0/s1 |
AMDU - Physico-chemical Properties
| Molecular Formula | C9H13N3O4 |
| Molar Mass | 227.22 |
| Density | 1.425 |
| Melting Point | 174-176℃ |
| Refractive Index | 1.58 |
AMDU - Introduction
3 '-amino-2',3 '-dideoxyuridine is a nucleoside compound, its chemical structure is 3'-amino-2 ',3'-dideoxyuridine. Its properties are as follows:
1. Appearance: white powder
2. Solubility: Soluble in water and some organic solvents
3. melting point: about 215-217 ℃
3 '-amino-2',3 '-dideoxyuridine has a wide range of uses in the field of medicine, mainly used to study its effect in antiviral drugs. Because of the characteristics of its structure containing deoxynucleoside, it can be used as an important viral DNA chain terminator to inhibit the replication process of the virus.
The method of preparing 3 '-amino-2',3 '-dideoxyuridine includes the following steps:
1. First, uridine is converted into 2 ',3'-dideoxyuridine by chemical synthesis.
2. Then, 2 ',3'-dideoxyuridine is reacted with an appropriate amination reagent to introduce an amino group into the molecule to form 3 '-amino-2',3 '-dideoxyuridine.
When using 3 '-amino-2',3 '-dideoxyuridine, you need to pay attention to the following safety information:
1. Take necessary safety operations and equipment to avoid direct contact with skin and eyes.
2. Avoid inhaling the dust or gas of the compound, and operate in a well-ventilated area.
3. storage should be sealed, away from high temperature and fire.
4. When using or handling the compound, you should comply with the chemical safety practices and relevant regulations, and pay attention to personal protection and safety measures.
1. Appearance: white powder
2. Solubility: Soluble in water and some organic solvents
3. melting point: about 215-217 ℃
3 '-amino-2',3 '-dideoxyuridine has a wide range of uses in the field of medicine, mainly used to study its effect in antiviral drugs. Because of the characteristics of its structure containing deoxynucleoside, it can be used as an important viral DNA chain terminator to inhibit the replication process of the virus.
The method of preparing 3 '-amino-2',3 '-dideoxyuridine includes the following steps:
1. First, uridine is converted into 2 ',3'-dideoxyuridine by chemical synthesis.
2. Then, 2 ',3'-dideoxyuridine is reacted with an appropriate amination reagent to introduce an amino group into the molecule to form 3 '-amino-2',3 '-dideoxyuridine.
When using 3 '-amino-2',3 '-dideoxyuridine, you need to pay attention to the following safety information:
1. Take necessary safety operations and equipment to avoid direct contact with skin and eyes.
2. Avoid inhaling the dust or gas of the compound, and operate in a well-ventilated area.
3. storage should be sealed, away from high temperature and fire.
4. When using or handling the compound, you should comply with the chemical safety practices and relevant regulations, and pay attention to personal protection and safety measures.
Last Update：2024-04-09 21:04:16
