BENZYL-DL-SERINE
3-Benzyloxy-DL-alanine
CAS: 5445-44-3;32520-12-0
Molecular Formula: C10H13NO3
BENZYL-DL-SERINE - Names and Identifiers
| Name | 3-Benzyloxy-DL-alanine |
| Synonyms | O-benzylserine BENZYL-DL-SERINE H-DL-SER(BZL)-OH H-DL-Ser(Bzl)-OH O-BENZYL-DL-SERINE O-Benzyl-DL-serine DL-SERINE BENZYL ESTER 3-benzyloxy-DL-alanine 3-Benzyloxy-DL-alanine O-BENZYL-DL-SERINE CRYSTALLINE |
| CAS | 5445-44-3 32520-12-0 |
| EINECS | 226-650-7 |
| InChI | InChI=1/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13) |
BENZYL-DL-SERINE - Physico-chemical Properties
| Molecular Formula | C10H13NO3 |
| Molar Mass | 195.22 |
| Density | 1.217 |
| Melting Point | ~227°C (dec.) |
| Boling Point | 359℃ |
| Flash Point | 171℃ |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 8.83E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| BRN | 3204905 |
| pKa | 2.10±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.56 |
| MDL | MFCD00021724 |
BENZYL-DL-SERINE - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29225090 |
BENZYL-DL-SERINE - Introduction
3-Benzyloxy-DL-alanine(3-Benzyloxy-DL-alanine) is an organic compound with the following properties:
1. Appearance: White crystalline solid.
2. solubility: soluble in water and organic solvents, such as alcohols and ether solvents.
3. Melting point: about 156-160°C.
The main uses of 3-benzyloxy-DL-alanine are as follows:
1. Serine (serine) protecting group: Serine is protected with 3-Benzyloxy-DL-alanine to prevent non-specific reactions during chemical synthesis.
2. alanine synthesis: 3-Benzyloxy-DL-alanine can be used to synthesize alanine, and the protecting group can be removed by appropriate reaction to obtain alanine.
3-Benzyloxy-DL-alanine is prepared as follows:
1. Benzyl alcohol is reacted with DL-serine to produce 3-benzyloxy-DL-alanine.
2. under appropriate conditions, after crystallization or extraction, pure 3-Benzyloxy-DL-alanine product can be obtained.
Regarding the safety information of 3-Benzyloxy-DL-alanine, the following matters should be paid attention to during use and operation:
1.3-Benzyloxy-DL-alanine may cause irritation to the eyes, skin and respiratory tract, so you should wear appropriate protective equipment, such as gloves, goggles and masks.
2. Avoid inhaling dust or entering the mouth, and operate in a well-ventilated place.
3. Keep dry during storage and avoid contact with oxidants, acids and alkalis to prevent dangerous reactions.
4. when there is any discomfort or inadvertent contact with it, immediately wash the affected parts, and seek medical assistance.
1. Appearance: White crystalline solid.
2. solubility: soluble in water and organic solvents, such as alcohols and ether solvents.
3. Melting point: about 156-160°C.
The main uses of 3-benzyloxy-DL-alanine are as follows:
1. Serine (serine) protecting group: Serine is protected with 3-Benzyloxy-DL-alanine to prevent non-specific reactions during chemical synthesis.
2. alanine synthesis: 3-Benzyloxy-DL-alanine can be used to synthesize alanine, and the protecting group can be removed by appropriate reaction to obtain alanine.
3-Benzyloxy-DL-alanine is prepared as follows:
1. Benzyl alcohol is reacted with DL-serine to produce 3-benzyloxy-DL-alanine.
2. under appropriate conditions, after crystallization or extraction, pure 3-Benzyloxy-DL-alanine product can be obtained.
Regarding the safety information of 3-Benzyloxy-DL-alanine, the following matters should be paid attention to during use and operation:
1.3-Benzyloxy-DL-alanine may cause irritation to the eyes, skin and respiratory tract, so you should wear appropriate protective equipment, such as gloves, goggles and masks.
2. Avoid inhaling dust or entering the mouth, and operate in a well-ventilated place.
3. Keep dry during storage and avoid contact with oxidants, acids and alkalis to prevent dangerous reactions.
4. when there is any discomfort or inadvertent contact with it, immediately wash the affected parts, and seek medical assistance.
Last Update：2024-04-09 21:21:28
Supplier List
Product Name: O-Benzyl-DL-Serine Visit Supplier Webpage Request for quotation
CAS: 5445-44-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5445-44-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: O-Benzyl-DL-Serine Visit Supplier Webpage Request for quotation
CAS: 5445-44-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5445-44-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History