BOC-D-Cyclopropylalanine
Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA
CAS: 89483-09-0
Molecular Formula: C23H42N2O4
BOC-D-Cyclopropylalanine - Names and Identifiers
| Name | Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA |
| Synonyms | BOC-D-Cyclopropylalanine Boc-D-Cyclopropylalanine Boc-D-Cyclopentyl-alanine BOC-D-CYCLOPROPYLALANINE-DCHA Boc-D-Cyclopropylalanine-Dcha Boc-b-cyclopropyl-D-Ala-OH·DCHA Boc-(R)-3-Cyclopropylalanine DCHA BOC-BETA-CYCLOPROPYL-D-ALA-OH DCHA BOC-BETA-CYCLOPROPYL-D-ALANINE DCHA Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA BOC-D-ALA(BETA-CYCLOPROPYL)-OH DICYCLOHEXYLAMMONIUM SALT N-ALPHA-T-BUTOXYCARBONYL-BETA-CYCLOPROPYL-D-ALANINE DICYCLOHEXYLAMMONIUM SALT |
| CAS | 89483-09-0 |
| InChI | InChI=1/C12H23N.C11H19NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-11(2,3)16-10(15)12-8(9(13)14)6-7-4-5-7/h11-13H,1-10H2;7-8H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t;8-/m.1/s1 |
BOC-D-Cyclopropylalanine - Physico-chemical Properties
| Molecular Formula | C23H42N2O4 |
| Molar Mass | 410.59 |
| Boling Point | 377.2°C at 760 mmHg |
| Flash Point | 181.9°C |
| Vapor Presure | 9.93E-07mmHg at 25°C |
| Storage Condition | Inert atmosphere,2-8°C |
BOC-D-Cyclopropylalanine - Risk and Safety
| HS Code | 29225090 |
BOC-D-Cyclopropylalanine - Introduction
Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA(Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA) is a chemical substance with the following properties:
1. Appearance: white solid
2. molecular formula: C19H32N2O4
3. Molecular weight: 352.47g/mol
4. Melting point: 110-112°C
5. Solubility: Soluble in organic solvents such as methanol and dimethylformamide, slightly soluble in water.
Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is mainly used in peptide synthesis and drug research. It is a commonly used protecting group that can be used to prevent non-specific reactions of amino acid side chains, thereby achieving selectivity and high efficiency in peptide chain synthesis.
The method for preparing Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is as follows:
1. First, N-tert-butoxycarbonyl-D-cyclopropylalanine (Boc-.beta.-cyclopropyl-D-Ala-OH) and dicyclohexylamine (DCHA) are mixed in a molar ratio.
2. Dissolve the mixture in an appropriate amount of an organic solvent (such as dimethylformamide).
3. at the appropriate temperature, reaction for several hours to several days.
4. The product was filtered and freeze-dried to obtain the pure product.
Regarding safety information, Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is a chemical substance, and the following matters should be paid attention to when using it:
1. Avoid contact with skin and eyes. If contact occurs, rinse immediately with plenty of water and seek medical help.
2. in the use of the process to maintain good ventilation conditions, to avoid the inhalation of dust or gas.
3. Store in a dry, cool, well-ventilated place, and away from fire or heat sources.
4. When using and storing the compound, strictly follow the chemical safety procedures and wear appropriate personal protective equipment.
1. Appearance: white solid
2. molecular formula: C19H32N2O4
3. Molecular weight: 352.47g/mol
4. Melting point: 110-112°C
5. Solubility: Soluble in organic solvents such as methanol and dimethylformamide, slightly soluble in water.
Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is mainly used in peptide synthesis and drug research. It is a commonly used protecting group that can be used to prevent non-specific reactions of amino acid side chains, thereby achieving selectivity and high efficiency in peptide chain synthesis.
The method for preparing Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is as follows:
1. First, N-tert-butoxycarbonyl-D-cyclopropylalanine (Boc-.beta.-cyclopropyl-D-Ala-OH) and dicyclohexylamine (DCHA) are mixed in a molar ratio.
2. Dissolve the mixture in an appropriate amount of an organic solvent (such as dimethylformamide).
3. at the appropriate temperature, reaction for several hours to several days.
4. The product was filtered and freeze-dried to obtain the pure product.
Regarding safety information, Boc-.beta.-cyclopropyl-D-Ala-OH . DCHA is a chemical substance, and the following matters should be paid attention to when using it:
1. Avoid contact with skin and eyes. If contact occurs, rinse immediately with plenty of water and seek medical help.
2. in the use of the process to maintain good ventilation conditions, to avoid the inhalation of dust or gas.
3. Store in a dry, cool, well-ventilated place, and away from fire or heat sources.
4. When using and storing the compound, strictly follow the chemical safety procedures and wear appropriate personal protective equipment.
Last Update：2024-04-09 21:01:54
